# probenecid (Q900898)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P274 | Formula | C₁₃H₁₉NO₄S |  |  |  |  |  | normal | PubChem |
| P2175 | Medical condition treated | gout attack | Q6081223 |  |  |  |  | normal | NDF-RT |
| P2175 | Medical condition treated | gonorrhea | Q101896 |  |  |  |  | normal | NDF-RT |
| P2175 | Medical condition treated | tertiary neurosyphilis | Q18558279 |  |  |  |  | normal | NDF-RT |
| P233 | Canonical SMILES | CCCN(CCC)S(=O)(=O)C1=CC=C(C=C1)C(=O)O |  |  |  |  |  | normal | PubChem |
| P2275 | World Health Organisation  international non-proprietary name | probenecid |  |  |  |  |  | normal | ChEBI |
| P2067 | Mass | 285.1035 Da |  | 285.103479 | Da |  |  | normal | PubChem |
| P4250 | Defined daily dose | 1 g |  | 1 | g |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=M04AB01 |
| P2868 | Subject has role | uricosuric agents | Q50430189 |  |  |  |  | normal | Medical Subject Headings |
| P2868 | Subject has role | pharmaceutic adjuvants | Q50429633 |  |  |  |  | normal | Medical Subject Headings |
| P129 | Physically interacts with | Solute carrier organic anion transporter family member 1C1 | Q21125249 |  |  |  |  | normal | IUPHAR/BPS Guide to PHARMACOLOGY |
| P129 | Physically interacts with | Solute carrier family 22 member 6 | Q21111553 |  |  |  |  | normal | IUPHAR/BPS Guide to PHARMACOLOGY |
| P2101 | Melting point | 199°C |  | 199 | °C |  |  | normal | Jean-Claude Bradley Open Melting Point Dataset |
| P366 | Has use | medication | Q12140 |  |  |  |  | normal |  |
| P279 | Subclass of | chemical compound | Q11173 |  |  |  |  | normal |  |
| P267 | ATC code | M04AB01 |  |  |  |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=M04AB01 |
| P11931 | CAMEO Chemicals ID | 20951 |  |  |  |  |  | normal | https://cameochemicals.noaa.gov/chemical/20951 |
| P231 | CAS Registry Number | 57-66-9 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=57-66-9 |
| P683 | ChEBI ID | 8426 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:8426 |
| P592 | ChEMBL ID | CHEMBL897 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL897/ |
| P661 | ChemSpider ID | 4742 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.4742.html |
| P9272 | DeCS ID | 27768 |  |  |  |  |  | normal | https://decs.bvsalud.org/en/ths/resource/?id=27768 |
| P715 | DrugBank ID | DB01032 |  |  |  |  |  | normal | https://go.drugbank.com/drugs/DB01032 |
| P11198 | DrugCentral ID | 2268 |  |  |  |  |  | normal | https://drugcentral.org/drugcard/2268 |
| P8494 | DSSTOX compound identifier | DTXCID901188 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID901188 |
| P3117 | DSSTox substance ID | DTXSID9021188 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID9021188 |
| P232 | EC number | 200-344-3 |  |  |  |  |  | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/200-344-3 |
| P2566 | ECHA Substance Infocard ID | 100.000.313 |  |  |  |  |  | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.000.313 |
| P9635 | Electronic Essential Medicines List medicine ID | 538 |  |  |  |  |  | normal | https://list.essentialmeds.org/medicines/538 |
| P1417 | Encyclopædia Britannica Online ID | science/probenecid |  |  |  |  |  | normal | https://www.britannica.com/science/probenecid |
| P646 | Freebase ID | /m/08zjdq |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/08zjdq |
| P595 | Guide to Pharmacology Ligand ID | 4357 |  |  |  |  |  | normal | https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4357 |
| P2062 | HSDB ID | 3387 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3387 |
| P2057 | Human Metabolome Database ID | HMDB0015166 |  |  |  |  |  | normal | https://www.hmdb.ca/metabolites/HMDB0015166 |
| P4168 | IEDB Epitope ID | 180853 |  |  |  |  |  | normal | http://www.iedb.org/epitope/180853 |
| P234 | InChI | InChI=1S/C13H19NO4S/c1-3-9-14(10-4-2)19(17,18)12-7-5-11(6-8-12)13(15)16/h5-8H,3-4,9-10H2,1-2H3,(H,15,16) |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C13H19NO4S/c1-3-9-14(10-4-2)19(17%2C18)12-7-5-11(6-8-12)13(15)16/h5-8H%2C3-4%2C9-10H2%2C1-2H3%2C(H%2C15%2C16) |
| P235 | InChIKey | DBABZHXKTCFAPX-UHFFFAOYSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22DBABZHXKTCFAPX-UHFFFAOYSA-N%22%5BInChIKey%5D |
| P5063 | Interlingual Index ID | i57691 |  |  |  |  |  | normal | https://globalwordnet.github.io/cili/i57691 |
| P665 | KEGG ID | C07372 |  |  |  |  |  | normal | https://www.kegg.jp/entry/C07372 |
| P6689 | MassBank accession ID | MSBNK-LCSB-LU020851 |  |  |  |  |  | normal | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-LCSB-LU020851 |
| P10245 | MedlinePlus drug identifier | a682395 |  |  |  |  |  | normal | https://medlineplus.gov/druginfo/meds/a682395.html |
| P6694 | MeSH concept ID | M0017601 |  |  |  |  |  | normal | https://id.nlm.nih.gov/mesh/M0017601 |
| P486 | MeSH descriptor ID | D011339 |  |  |  |  |  | normal | https://meshb.nlm.nih.gov/record/ui?ui=D011339 |
| P672 | MeSH tree code | D02.065.884.625 |  |  |  |  |  | normal | https://id.nlm.nih.gov/mesh/D02.065.884.625 |
| P6366 | Microsoft Academic ID (discontinued) | 2776769776 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2776769776 |
| P2115 | NDF-RT ID | N0000146225 |  |  |  |  |  | normal | https://bioportal.bioontology.org/ontologies/NDFRT?p=classes&conceptid=N0000146225 |
| P2840 | NSC number | 18786 |  |  |  |  |  | normal | https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=18786&Submit=Submit |
| P10283 | OpenAlex ID | C2776769776 |  |  |  |  |  | normal | https://openalex.org/C2776769776 |
| P4235 | PatientsLikeMe treatment ID | probenecid |  |  |  |  |  | normal | https://www.patientslikeme.com/treatments/show/probenecid |
| P3636 | PDB ligand ID | RTO |  |  |  |  |  | normal | https://www.rcsb.org/ligand/RTO |
| P11199 | Probes And Drugs ID | PD001786 |  |  |  |  |  | normal | https://www.probes-drugs.org/compound/PD001786 |
| P662 | PubChem CID | 4911 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/4911 |
| P1579 | Reaxys registry number | 2815775 |  |  |  |  |  | normal |  |
| P5076 | Römpp online ID | RD-16-04148 |  |  |  |  |  | normal | https://roempp.thieme.de/lexicon/RD-16-04148 |
| P3345 | RxNorm CUI | 8698 |  |  |  |  |  | normal | https://mor.nlm.nih.gov/RxNav/search?searchBy=RXCUI&searchTerm=8698 |
| P4964 | SPLASH | splash10-0f76-0190000000-ce053a8c64308bc3ebbb |  |  |  |  |  | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-0f76-0190000000-ce053a8c64308bc3ebbb') |
| P5082 | Store medisinske leksikon ID | probenecid |  |  |  |  |  | normal | https://wikidata-externalid-url.toolforge.org/?p=5082&url_prefix=https://sml.snl.no/&id=probenecid |
| P2877 | SureChEMBL ID | 3663 |  |  |  |  |  | normal | https://www.surechembl.org/chemical/3663 |
| P2892 | UMLS CUI | C0033209 |  |  |  |  |  | normal | https://evsexplore.semantics.cancer.gov/evsexplore/concept/ncim/C0033209 |
| P11089 | UniChem compound ID | 220921 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=220921 |
| P652 | UNII | PO572Z7917 |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/PO572Z7917 |
| P2167 | UNSPSC code | 51211503 |  |  |  |  |  | normal |  |
| P13204 | Wellcome Collection concept ID | bcn36chx |  |  |  |  |  | normal | https://wellcomecollection.org/concepts/bcn36chx |
| P11143 | WikiProjectMed ID | Probenecid |  |  |  |  |  | normal | https://mdwiki.org/wiki/Probenecid |
| P8814 | WordNet 3.1 Synset ID | 04012960-n |  |  |  |  |  | normal | https://en-word.net/view/synset/04012960-n |

Source: https://aidb.si/e/probenecid-Q900898 — Wikidata (CC0) via AIDB