# pheniramine (Q656259)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P274 | Formula | C₁₆H₂₀N₂ |  |  |  |  |  | normal | PubChem |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P2175 | Medical condition treated | urticaria | Q187440 |  |  |  |  | normal | NDF-RT |
| P233 | Canonical SMILES | CN(C)CCC(C1=CC=CC=C1)C2=CC=CC=N2 |  |  |  |  |  | normal | PubChem |
| P2067 | Mass | 240.1626 Da |  | 240.162649 | Da |  |  | normal | PubChem |
| P3489 | Pregnancy category | Australian pregnancy category A | Q3679189 |  |  |  |  | normal |  |
| P3489 | Pregnancy category | US pregnancy category C | Q28123617 |  |  |  |  | normal |  |
| P4250 | Defined daily dose | 75 milligram |  | 75 | milligram |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=R06AB05 |
| P2868 | Subject has role | H1 antagonist | Q1328275 |  |  |  |  | normal | NDF-RT \| Medical Subject Headings |
| P2868 | Subject has role | anti-allergic agents | Q50430264 |  |  |  |  | normal | Medical Subject Headings |
| P2868 | Subject has role | antipruritic | Q2853347 |  |  |  |  | normal | Medical Subject Headings |
| P366 | Has use | medication | Q12140 |  |  |  |  | normal |  |
| P279 | Subclass of | chemical compound | Q11173 |  |  |  |  | normal |  |
| P267 | ATC code | D04AA16 |  |  |  |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=D04AA16 |
| P231 | CAS Registry Number | 86-21-5 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=86-21-5 |
| P683 | ChEBI ID | 91591 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:91591 |
| P592 | ChEMBL ID | CHEMBL1193 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL1193/ |
| P661 | ChemSpider ID | 4597 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.4597.html |
| P715 | DrugBank ID | DB01620 |  |  |  |  |  | normal | https://go.drugbank.com/drugs/DB01620 |
| P11198 | DrugCentral ID | 2132 |  |  |  |  |  | normal | https://drugcentral.org/drugcard/2132 |
| P8494 | DSSTOX compound identifier | DTXCID203454 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID203454 |
| P3117 | DSSTox substance ID | DTXSID0023454 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID0023454 |
| P232 | EC number | 201-656-2 |  |  |  |  |  | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/201-656-2 |
| P2566 | ECHA Substance Infocard ID | 100.001.506 |  |  |  |  |  | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.001.506 |
| P646 | Freebase ID | /m/0d39h7 |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/0d39h7 |
| P595 | Guide to Pharmacology Ligand ID | 7267 |  |  |  |  |  | normal | https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7267 |
| P2057 | Human Metabolome Database ID | HMDB0015557 |  |  |  |  |  | normal | https://www.hmdb.ca/metabolites/HMDB0015557 |
| P234 | InChI | InChI=1S/C16H20N2/c1-18(2)13-11-15(14-8-4-3-5-9-14)16-10-6-7-12-17-16/h3-10,12,15H,11,13H2,1-2H3 |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C16H20N2/c1-18(2)13-11-15(14-8-4-3-5-9-14)16-10-6-7-12-17-16/h3-10%2C12%2C15H%2C11%2C13H2%2C1-2H3 |
| P235 | InChIKey | IJHNSHDBIRRJRN-UHFFFAOYSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22IJHNSHDBIRRJRN-UHFFFAOYSA-N%22%5BInChIKey%5D |
| P665 | KEGG ID | D08355 |  |  |  |  |  | normal | https://www.kegg.jp/entry/D08355 |
| P6689 | MassBank accession ID | MSBNK-Eawag-EQ300501 |  |  |  |  |  | normal | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Eawag-EQ300501 |
| P486 | MeSH descriptor ID | D010632 |  |  |  |  |  | normal | https://meshb.nlm.nih.gov/record/ui?ui=D010632 |
| P672 | MeSH tree code | D03.383.725.620 |  |  |  |  |  | normal | https://id.nlm.nih.gov/mesh/D03.383.725.620 |
| P6366 | Microsoft Academic ID (discontinued) | 2778337516 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2778337516 |
| P2115 | NDF-RT ID | N0000147973 |  |  |  |  |  | normal | https://bioportal.bioontology.org/ontologies/NDFRT?p=classes&conceptid=N0000147973 |
| P2840 | NSC number | 47965 |  |  |  |  |  | normal | https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=47965&Submit=Submit |
| P11199 | Probes And Drugs ID | PD009444 |  |  |  |  |  | normal | https://www.probes-drugs.org/compound/PD009444 |
| P662 | PubChem CID | 4761 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/4761 |
| P5076 | Römpp online ID | RD-16-01570 |  |  |  |  |  | normal | https://roempp.thieme.de/lexicon/RD-16-01570 |
| P3345 | RxNorm CUI | 8132 |  |  |  |  |  | normal | https://mor.nlm.nih.gov/RxNav/search?searchBy=RXCUI&searchTerm=8132 |
| P4964 | SPLASH | splash10-0002-0900000000-7af6ac1b513c7f2f33a9 |  |  |  |  |  | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-0002-0900000000-7af6ac1b513c7f2f33a9') |
| P2877 | SureChEMBL ID | 4796 |  |  |  |  |  | normal | https://www.surechembl.org/chemical/4796 |
| P2892 | UMLS CUI | C0031408 |  |  |  |  |  | normal | https://evsexplore.semantics.cancer.gov/evsexplore/concept/ncim/C0031408 |
| P11089 | UniChem compound ID | 425193 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=425193 |
| P652 | UNII | 134FM9ZZ6M |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/134FM9ZZ6M |
| P8814 | WordNet 3.1 Synset ID | 03928037-n |  |  |  |  |  | normal | https://en-word.net/view/synset/03928037-n |

Source: https://aidb.si/e/pheniramine-Q656259 — Wikidata (CC0) via AIDb