# flunitrazepam (Q62947)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P274 | Formula | C₁₆H₁₂FN₃O₃ |  |  |  |  |  | normal | PubChem |
| P2275 | World Health Organisation  international non-proprietary name | flunitrazepam |  |  |  |  |  | normal | ChEMBL |
| P233 | Canonical SMILES | CN1C(=O)CN=C(C2=C1C=CC(=C2)[N+](=O)[O-])C3=CC=CC=C3F |  |  |  |  |  | normal | PubChem |
| P2067 | Mass | 313.0863 Da |  | 313.086269 | Da |  |  | normal | PubChem |
| P3489 | Pregnancy category | Australian pregnancy category C | Q3679261 |  |  |  |  | normal |  |
| P2868 | Subject has role | anxiolytic | Q62903 |  |  |  |  | normal | Medical Subject Headings |
| P2868 | Subject has role | GABA Modulators | Q50430260 |  |  |  |  | normal | Medical Subject Headings |
| P129 | Physically interacts with | Gamma-aminobutyric acid type A receptor subunit alpha1 | Q5520260 |  |  |  |  | normal | IUPHAR/BPS Guide to PHARMACOLOGY |
| P129 | Physically interacts with | Gamma-aminobutyric acid type A receptor subunit alpha2 | Q21114582 |  |  |  |  | normal | IUPHAR/BPS Guide to PHARMACOLOGY |
| P129 | Physically interacts with | Gamma-aminobutyric acid type A receptor subunit alpha3 | Q21114578 |  |  |  |  | normal | IUPHAR/BPS Guide to PHARMACOLOGY |
| P129 | Physically interacts with | Gamma-aminobutyric acid type A receptor subunit alpha5 | Q21114576 |  |  |  |  | normal | IUPHAR/BPS Guide to PHARMACOLOGY |
| P1987 | MCN code | 2933.91.32 |  |  |  |  |  | normal |  |
| P4250 | Defined daily dose | 1 milligram |  | 1 | milligram |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=N05CD03 |
| P4250 | Defined daily dose | 1 milligram |  | 1 | milligram |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=N05CD03 |
| P366 | Has use | medication | Q12140 |  |  |  |  | normal |  |
| P279 | Subclass of | chemical compound | Q11173 |  |  |  |  | normal |  |
| P14834 | Substance control status | Schedule III (Russia) | Q141130841 |  |  |  |  | normal | https://www.consultant.ru/document/cons_doc_LAW_19243/ |
| P14834 | Substance control status | Schedule 8 (Australia) | Q141130932 |  |  |  |  | normal |  |
| P14834 | Substance control status | Schedule I (Canada) | Q141130934 |  |  |  |  | normal |  |
| P14834 | Substance control status | Anlage III (Germany) | Q141130922 |  |  |  |  | normal |  |
| P14834 | Substance control status | Class C (United Kingdom) | Q141130919 |  |  |  |  | normal |  |
| P14834 | Substance control status | Schedule III (Convention on Psychotropic Substances 1971) | Q141130930 |  |  |  |  | normal |  |
| P267 | ATC code | N05CD03 |  |  |  |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=N05CD03 |
| P231 | CAS Registry Number | 1622-62-4 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=1622-62-4 |
| P683 | ChEBI ID | 31622 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:31622 |
| P592 | ChEMBL ID | CHEMBL13280 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL13280/ |
| P661 | ChemSpider ID | 3263 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.3263.html |
| P715 | DrugBank ID | DB01544 |  |  |  |  |  | normal | https://go.drugbank.com/drugs/DB01544 |
| P11198 | DrugCentral ID | 1202 |  |  |  |  |  | normal | https://drugcentral.org/drugcard/1202 |
| P8494 | DSSTOX compound identifier | DTXCID103065 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID103065 |
| P3117 | DSSTox substance ID | DTXSID7023065 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID7023065 |
| P232 | EC number | 216-597-8 |  |  |  |  |  | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/216-597-8 |
| P2566 | ECHA Substance Infocard ID | 100.015.089 |  |  |  |  |  | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.015.089 |
| P1417 | Encyclopædia Britannica Online ID | topic/Rohypnol |  |  |  |  |  | normal | https://www.britannica.com/topic/Rohypnol |
| P646 | Freebase ID | /m/033b3 |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/033b3 |
| P227 | GND ID | 4154795-0 |  |  |  |  |  | normal | https://d-nb.info/gnd/4154795-0 |
| P595 | Guide to Pharmacology Ligand ID | 4193 |  |  |  |  |  | normal | https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4193 |
| P2062 | HSDB ID | 6960 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6960 |
| P2057 | Human Metabolome Database ID | HMDB0015510 |  |  |  |  |  | normal | https://www.hmdb.ca/metabolites/HMDB0015510 |
| P234 | InChI | InChI=1S/C16H12FN3O3/c1-19-14-7-6-10(20(22)23)8-12(14)16(18-9-15(19)21)11-4-2-3-5-13(11)17/h2-8H,9H2,1H3 |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C16H12FN3O3/c1-19-14-7-6-10(20(22)23)8-12(14)16(18-9-15(19)21)11-4-2-3-5-13(11)17/h2-8H%2C9H2%2C1H3 |
| P235 | InChIKey | PPTYJKAXVCCBDU-UHFFFAOYSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22PPTYJKAXVCCBDU-UHFFFAOYSA-N%22%5BInChIKey%5D |
| P8189 | J9U entity ID | 987007538446205171 |  |  |  |  |  | normal | https://www.nli.org.il/en/authorities/987007538446205171 |
| P8408 | KBpedia ID | Flunitrazepam |  |  |  |  |  | normal | https://kbpedia.org/knowledge-graph/reference-concept/?uri=Flunitrazepam |
| P665 | KEGG ID | D01230 |  |  |  |  |  | normal | https://www.kegg.jp/entry/D01230 |
| P920 | LEM ID | LEM201003901 |  |  |  |  |  | normal | http://id.sgcb.mcu.es/Autoridades/LEM201003901/concept.html |
| P244 | Library of Congress Authorities ID | sh85049403 |  |  |  |  |  | normal | https://id.loc.gov/authorities/sh85049403 |
| P6689 | MassBank accession ID | MSBNK-Athens_Univ-AU159502 |  |  |  |  |  | normal | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Athens_Univ-AU159502 |
| P486 | MeSH descriptor ID | D005445 |  |  |  |  |  | normal | https://meshb.nlm.nih.gov/record/ui?ui=D005445 |
| P672 | MeSH tree code | D03.633.100.079.080.070.320 |  |  |  |  |  | normal | https://id.nlm.nih.gov/mesh/D03.633.100.079.080.070.320 |
| P6366 | Microsoft Academic ID (discontinued) | 2781442855 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2781442855 |
| P950 | National Library of Spain SpMaBN ID | XX545165 |  |  |  |  |  | normal | https://datos.bne.es/resource/XX545165 |
| P3222 | NE.se ID | flunitrazepam |  |  |  |  |  | normal | https://www.ne.se/uppslagsverk/encyklopedi/lång/flunitrazepam |
| P691 | NL CR AUT ID | ph731737 |  |  |  |  |  | normal | https://aleph.nkp.cz/F/?func=find-c&local_base=aut&ccl_term=ica=ph731737 |
| P9405 | NMRShiftDB structure ID | 20233880 |  |  |  |  |  | normal | https://nmrshiftdb.nmr.uni-koeln.de/molecule/20233880 |
| P10283 | OpenAlex ID | C2781442855 |  |  |  |  |  | normal | https://openalex.org/C2781442855 |
| P11199 | Probes And Drugs ID | PD009482 |  |  |  |  |  | normal | https://www.probes-drugs.org/compound/PD009482 |
| P662 | PubChem CID | 3380 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/3380 |
| P3417 | Quora topic ID | Rohypnol |  |  |  |  |  | normal | https://www.quora.com/topic/Rohypnol |
| P5076 | Römpp online ID | RD-06-01338 |  |  |  |  |  | normal | https://roempp.thieme.de/lexicon/RD-06-01338 |
| P3345 | RxNorm CUI | 4460 |  |  |  |  |  | normal | https://mor.nlm.nih.gov/RxNav/search?searchBy=RXCUI&searchTerm=4460 |
| P4964 | SPLASH | splash10-02t9-0098000000-ed4fc29ca5e103e7e7ac |  |  |  |  |  | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-02t9-0098000000-ed4fc29ca5e103e7e7ac') |
| P5082 | Store medisinske leksikon ID | Rohypnol |  |  |  |  |  | normal | https://wikidata-externalid-url.toolforge.org/?p=5082&url_prefix=https://sml.snl.no/&id=Rohypnol |
| P2877 | SureChEMBL ID | 44169 |  |  |  |  |  | normal | https://www.surechembl.org/chemical/44169 |
| P4527 | UK Parliament thesaurus ID | 519759 |  |  |  |  |  | normal | https://lda.data.parliament.uk/terms/519759.html |
| P11089 | UniChem compound ID | 172989 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=172989 |
| P652 | UNII | 620X0222FQ |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/620X0222FQ |
| P2167 | UNSPSC code | 51141807 |  |  |  |  |  | normal |  |
| P13204 | Wellcome Collection concept ID | wc9mtwm6 |  |  |  |  |  | normal | https://wellcomecollection.org/concepts/wc9mtwm6 |
| P11143 | WikiProjectMed ID | Flunitrazepam |  |  |  |  |  | normal | https://mdwiki.org/wiki/Flunitrazepam |
| P8814 | WordNet 3.1 Synset ID | 04042970-n |  |  |  |  |  | normal | https://en-word.net/view/synset/04042970-n |
| P13591 | Yale LUX ID | concept/6bffe7df-11fd-469b-bd5b-0e4d17255e5f |  |  |  |  |  | normal | https://lux.collections.yale.edu/view/concept/6bffe7df-11fd-469b-bd5b-0e4d17255e5f |

Source: https://aidb.si/e/flunitrazepam-Q62947 — Wikidata (CC0) via AIDB