# loperamide (Q423751)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P274 | Formula | C₂₉H₃₃ClN₂O₂ |  |  |  |  |  | normal | PubChem |
| P2175 | Medical condition treated | functional colonic disease | Q18556106 |  |  |  |  | normal | NDF-RT |
| P2175 | Medical condition treated | shigellosis | Q327298 |  |  |  |  | normal | NDF-RT |
| P2175 | Medical condition treated | substance abuse | Q3184856 |  |  |  |  | normal | Drug Indications Extracted from FAERS |
| P2175 | Medical condition treated | withdrawal symptom | Q4420149 |  |  |  |  | normal | Drug Indications Extracted from FAERS |
| P2175 | Medical condition treated | irritable bowel syndrome | Q838966 |  |  |  |  | normal | Drug Indications Extracted from FAERS |
| P233 | Canonical SMILES | CN(C)C(=O)C(CCN1CCC(CC1)(C2=CC=C(C=C2)Cl)O)(C3=CC=CC=C3)C4=CC=CC=C4 |  |  |  |  |  | normal | PubChem |
| P2275 | World Health Organisation  international non-proprietary name | loperamide |  |  |  |  |  | normal | ChEBI |
| P2067 | Mass | 476.2231 Da |  | 476.223056 | Da |  |  | normal | PubChem |
| P3489 | Pregnancy category | Australian pregnancy category B3 | Q3679234 |  |  |  |  | normal |  |
| P3489 | Pregnancy category | US pregnancy category C | Q28123617 |  |  |  |  | normal |  |
| P4250 | Defined daily dose | 10 milligram |  | 10 | milligram |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=A07DA03 |
| P4250 | Defined daily dose | 2 milligram |  | 2 | milligram |  |  | normal |  |
| P2868 | Subject has role | antidiarrhoeal | Q2742649 |  |  |  |  | normal | Medical Subject Headings |
| P2868 | Subject has role | WHO essential medicines | Q35456 |  |  |  |  | normal |  |
| P2868 | Subject has role | gastrointestinal agent | Q50377202 |  |  |  |  | normal |  |
| P1987 | MCN code | 2933.39.24 |  |  |  |  |  | normal |  |
| P129 | Physically interacts with | opioid receptor mu 1 | Q5123372 |  |  |  |  | normal | IUPHAR/BPS Guide to PHARMACOLOGY |
| P366 | Has use | medication | Q12140 |  |  |  |  | normal |  |
| P279 | Subclass of | chemical compound | Q11173 |  |  |  |  | normal |  |
| P1705 | Native label | Loperamide |  |  |  |  |  | normal |  |
| P267 | ATC code | A07DA03 |  |  |  |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=A07DA03 |
| P8072 | CAB ID | 33385 |  |  |  |  |  | normal | https://www.cabi.org/cabithesaurus/mtwdk.exe?k=default&l=60&w=33385&s=5&t=2 |
| P231 | CAS Registry Number | 53179-11-6 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=53179-11-6 |
| P683 | ChEBI ID | 6532 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:6532 |
| P592 | ChEMBL ID | CHEMBL841 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL841/ |
| P661 | ChemSpider ID | 3818 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.3818.html |
| P9272 | DeCS ID | 8314 |  |  |  |  |  | normal | https://decs.bvsalud.org/en/ths/resource/?id=8314 |
| P715 | DrugBank ID | DB00836 |  |  |  |  |  | normal | https://go.drugbank.com/drugs/DB00836 |
| P11198 | DrugCentral ID | 1599 |  |  |  |  |  | normal | https://drugcentral.org/drugcard/1599 |
| P8494 | DSSTOX compound identifier | DTXCID4025165 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID4025165 |
| P3117 | DSSTox substance ID | DTXSID6045165 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID6045165 |
| P232 | EC number | 258-416-5 |  |  |  |  |  | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/258-416-5 |
| P2566 | ECHA Substance Infocard ID | 100.053.088 |  |  |  |  |  | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.053.088 |
| P9635 | Electronic Essential Medicines List medicine ID | 28 |  |  |  |  |  | normal | https://list.essentialmeds.org/medicines/28 |
| P1417 | Encyclopædia Britannica Online ID | science/loperamide |  |  |  |  |  | normal | https://www.britannica.com/science/loperamide |
| P646 | Freebase ID | /m/01qydv |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/01qydv |
| P595 | Guide to Pharmacology Ligand ID | 7215 |  |  |  |  |  | normal | https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7215 |
| P2062 | HSDB ID | 8344 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8344 |
| P2057 | Human Metabolome Database ID | HMDB0004999 |  |  |  |  |  | normal | https://www.hmdb.ca/metabolites/HMDB0004999 |
| P234 | InChI | InChI=1S/C29H33ClN2O2/c1-31(2)27(33)29(24-9-5-3-6-10-24,25-11-7-4-8-12-25)19-22-32-20-17-28(34,18-21-32)23-13-15-26(30)16-14-23/h3-16,34H,17-22H2,1-2H3 |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C29H33ClN2O2/c1-31(2)27(33)29(24-9-5-3-6-10-24%2C25-11-7-4-8-12-25)19-22-32-20-17-28(34%2C18-21-32)23-13-15-26(30)16-14-23/h3-16%2C34H%2C17-22H2%2C1-2H3 |
| P235 | InChIKey | RDOIQAHITMMDAJ-UHFFFAOYSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22RDOIQAHITMMDAJ-UHFFFAOYSA-N%22%5BInChIKey%5D |
| P8189 | J9U entity ID | 987007536156905171 |  |  |  |  |  | normal | https://www.nli.org.il/en/authorities/987007536156905171 |
| P665 | KEGG ID | C07080 |  |  |  |  |  | normal | https://www.kegg.jp/entry/C07080 |
| P244 | Library of Congress Authorities ID | sh85078329 |  |  |  |  |  | normal | https://id.loc.gov/authorities/sh85078329 |
| P6689 | MassBank accession ID | SM848903 |  |  |  |  |  | normal | https://massbank.eu/MassBank/RecordDisplay?id=SM848903 |
| P10245 | MedlinePlus drug identifier | a682280 |  |  |  |  |  | normal | https://medlineplus.gov/druginfo/meds/a682280.html |
| P6694 | MeSH concept ID | M0012692 |  |  |  |  |  | normal | https://id.nlm.nih.gov/mesh/M0012692 |
| P486 | MeSH descriptor ID | D008139 |  |  |  |  |  | normal | https://meshb.nlm.nih.gov/record/ui?ui=D008139 |
| P672 | MeSH tree code | D03.383.621.440 |  |  |  |  |  | normal | https://id.nlm.nih.gov/mesh/D03.383.621.440 |
| P6366 | Microsoft Academic ID (discontinued) | 2777573665 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2777573665 |
| P1368 | National Library of Latvia ID | 000333374 |  |  |  |  |  | normal | https://kopkatalogs.lv/F/?func=direct&local_base=lnc10&doc_number=000333374 |
| P2115 | NDF-RT ID | N0000147893 |  |  |  |  |  | normal | https://bioportal.bioontology.org/ontologies/NDFRT?p=classes&conceptid=N0000147893 |
| P10283 | OpenAlex ID | C2777573665 |  |  |  |  |  | normal | https://openalex.org/C2777573665 |
| P4235 | PatientsLikeMe treatment ID | loperamide |  |  |  |  |  | normal | https://www.patientslikeme.com/treatments/show/loperamide |
| P11199 | Probes And Drugs ID | PD009698 |  |  |  |  |  | normal | https://www.probes-drugs.org/compound/PD009698 |
| P662 | PubChem CID | 3955 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/3955 |
| P1579 | Reaxys registry number | 1558273 |  |  |  |  |  | normal |  |
| P5076 | Römpp online ID | RD-12-01555 |  |  |  |  |  | normal | https://roempp.thieme.de/lexicon/RD-12-01555 |
| P3345 | RxNorm CUI | 6468 |  |  |  |  |  | normal | https://mor.nlm.nih.gov/RxNav/search?searchBy=RXCUI&searchTerm=6468 |
| P5806 | SNOMED CT ID | 387040009 |  |  |  |  |  | normal | https://browser.ihtsdotools.org/?perspective=full&conceptId1=387040009&languages=en |
| P4964 | SPLASH | splash10-004i-0020900000-f1be3181a6918c985ffd |  |  |  |  |  | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-004i-0020900000-f1be3181a6918c985ffd') |
| P2877 | SureChEMBL ID | 28530 |  |  |  |  |  | normal | https://www.surechembl.org/chemical/28530 |
| P2892 | UMLS CUI | C0023992 |  |  |  |  |  | normal | https://evsexplore.semantics.cancer.gov/evsexplore/concept/ncim/C0023992 |
| P11089 | UniChem compound ID | 21278 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=21278 |
| P652 | UNII | 6X9OC3H4II |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/6X9OC3H4II |
| P11143 | WikiProjectMed ID | Loperamide |  |  |  |  |  | normal | https://mdwiki.org/wiki/Loperamide |

Source: https://aidb.si/e/loperamide-Q423751 — Wikidata (CC0) via AIDB