# artemether (Q416199)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P274 | Formula | C₁₆H₂₆O₅ |  |  |  |  |  | normal | PubChem |
| P2017 | Isomeric SMILES | C[C@@H]1CC[C@H]2[C@H]([C@H](O[C@H]3[C@@]24[C@H]1CC[C@](O3)(OO4)C)OC)C |  |  |  |  |  | normal | PubChem |
| P233 | Canonical SMILES | CC1CCC2C(C(OC3C24C1CCC(O3)(OO4)C)OC)C |  |  |  |  |  | normal | PubChem |
| P2275 | World Health Organisation  international non-proprietary name | artemether |  |  |  |  |  | normal | ChEBI |
| P2067 | Mass | 298.178 Da |  | 298.178 | Da |  |  | normal | PubChem |
| P3489 | Pregnancy category | US pregnancy category C | Q28123617 |  |  |  |  | normal |  |
| P2868 | Subject has role | protein synthesis inhibitor | Q7251505 |  |  |  |  | normal | NDF-RT |
| P2868 | Subject has role | DNA polymerase inhibitors | Q4118287 |  |  |  |  | normal | NDF-RT |
| P2868 | Subject has role | antifungal | Q578726 |  |  |  |  | normal | Medical Subject Headings |
| P2868 | Subject has role | antimalarial | Q521616 |  |  |  |  | normal | Medical Subject Headings |
| P2868 | Subject has role | antiprotozoal | Q582559 |  |  |  |  | normal | Medical Subject Headings |
| P2868 | Subject has role | Coccidiostat | Q5139155 |  |  |  |  | normal | Medical Subject Headings |
| P2868 | Subject has role | schistosomicides | Q50430159 |  |  |  |  | normal | Medical Subject Headings |
| P2868 | Subject has role | WHO essential medicines | Q35456 |  |  |  |  | normal |  |
| P2868 | Subject has role | bactericide | Q804539 |  |  |  |  | normal | ChEBI |
| P366 | Has use | medication | Q12140 |  |  |  |  | normal | DrugBank |
| P3364 | Stereoisomer of | α-artemether | Q27251212 |  |  |  |  | normal |  |
| P279 | Subclass of | chemical compound | Q11173 |  |  |  |  | normal |  |
| P267 | ATC code | P01BE02 |  |  |  |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=P01BE02 |
| P231 | CAS Registry Number | 71963-77-4 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=71963-77-4 |
| P683 | ChEBI ID | 195280 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:195280 |
| P592 | ChEMBL ID | CHEMBL566534 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL566534/ |
| P661 | ChemSpider ID | 62138 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.62138.html |
| P9272 | DeCS ID | 57674 |  |  |  |  |  | normal | https://decs.bvsalud.org/en/ths/resource/?id=57674 |
| P715 | DrugBank ID | DB06697 |  |  |  |  |  | normal | https://go.drugbank.com/drugs/DB06697 |
| P11198 | DrugCentral ID | 245 |  |  |  |  |  | normal | https://drugcentral.org/drugcard/245 |
| P8494 | DSSTOX compound identifier | DTXCID30819889 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID30819889 |
| P3117 | DSSTox substance ID | DTXSID7040651 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID7040651 |
| P232 | EC number | 663-549-0 |  |  |  |  |  | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/663-549-0 |
| P2566 | ECHA Substance Infocard ID | 100.189.847 |  |  |  |  |  | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.189.847 |
| P9635 | Electronic Essential Medicines List medicine ID | 372 |  |  |  |  |  | normal | https://list.essentialmeds.org/medicines/372 |
| P646 | Freebase ID | /m/043tw2m |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/043tw2m |
| P595 | Guide to Pharmacology Ligand ID | 9955 |  |  |  |  |  | normal | https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=9955 |
| P2062 | HSDB ID | 7456 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7456 |
| P2057 | Human Metabolome Database ID | HMDB0015643 |  |  |  |  |  | normal | https://www.hmdb.ca/metabolites/HMDB0015643 |
| P234 | InChI | InChI=1S/C16H26O5/c1-9-5-6-12-10(2)13(17-4)18-14-16(12)11(9)7-8-15(3,19-14)20-21-16/h9-14H,5-8H2,1-4H3/t9-,10-,11+,12+,13+,14-,15-,16-/m1/s1 |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C16H26O5/c1-9-5-6-12-10(2)13(17-4)18-14-16(12)11(9)7-8-15(3%2C19-14)20-21-16/h9-14H%2C5-8H2%2C1-4H3/t9-%2C10-%2C11%2B%2C12%2B%2C13%2B%2C14-%2C15-%2C16-/m1/s1 |
| P235 | InChIKey | SXYIRMFQILZOAM-HVNFFKDJSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22SXYIRMFQILZOAM-HVNFFKDJSA-N%22%5BInChIKey%5D |
| P665 | KEGG ID | D02483 |  |  |  |  |  | normal | https://www.kegg.jp/entry/D02483 |
| P486 | MeSH descriptor ID | D000077549 |  |  |  |  |  | normal | https://meshb.nlm.nih.gov/record/ui?ui=D000077549 |
| P672 | MeSH tree code | D02.389.338.055.250 |  |  |  |  |  | normal | https://id.nlm.nih.gov/mesh/D02.389.338.055.250 |
| P6366 | Microsoft Academic ID (discontinued) | 2778118209 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2778118209 |
| P2115 | NDF-RT ID | N0000178417 |  |  |  |  |  | normal | https://bioportal.bioontology.org/ontologies/NDFRT?p=classes&conceptid=N0000178417 |
| P2840 | NSC number | 759820 |  |  |  |  |  | normal | https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=759820&Submit=Submit |
| P10283 | OpenAlex ID | C2778118209 |  |  |  |  |  | normal | https://openalex.org/C2778118209 |
| P3636 | PDB ligand ID | D8Z |  |  |  |  |  | normal | https://www.rcsb.org/ligand/D8Z |
| P11199 | Probes And Drugs ID | PD003141 |  |  |  |  |  | normal | https://www.probes-drugs.org/compound/PD003141 |
| P662 | PubChem CID | 68911 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/68911 |
| P1579 | Reaxys registry number | 6569878 |  |  |  |  |  | normal |  |
| P3345 | RxNorm CUI | 18343 |  |  |  |  |  | normal | https://mor.nlm.nih.gov/RxNav/search?searchBy=RXCUI&searchTerm=18343 |
| P4964 | SPLASH | splash10-03di-0950000000-2ae4d4c9200a42ec883d |  |  |  |  |  | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-03di-0950000000-2ae4d4c9200a42ec883d') |
| P2877 | SureChEMBL ID | 1650501 |  |  |  |  |  | normal | https://www.surechembl.org/chemical/1650501 |
| P2892 | UMLS CUI | C0052429 |  |  |  |  |  | normal | https://evsexplore.semantics.cancer.gov/evsexplore/concept/ncim/C0052429 |
| P11089 | UniChem compound ID | 1075487 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=1075487 |
| P652 | UNII | C7D6T3H22J |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/C7D6T3H22J |
| P11143 | WikiProjectMed ID | Artemether |  |  |  |  |  | normal | https://mdwiki.org/wiki/Artemether |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 6458 |  |  |  |  |  | normal | https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6458 |

Source: https://aidb.si/e/artemether-Q416199 — Wikidata (CC0) via AIDb