# ethion (Q414724)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P274 | Formula | C₉H₂₂O₄P₂S₄ |  |  |  |  |  | normal | PubChem |
| P1931 | NIOSH Pocket Guide ID | 0257 |  |  |  |  |  | normal |  |
| P2054 | Density | 1.22 g/cm³ |  | 1.22 | g/cm³ |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0257.html |
| P1542 | Has effect | ethion exposure | Q21174259 |  |  |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0257.html |
| P2101 | Melting point | 10°F |  | 10 | °F |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0257.html |
| P2119 | Vapor pressure | 1.5e-6 millimetre of mercury |  | 0.0000015 | millimetre of mercury |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0257.html |
| P2128 | Flash point | 349°F |  | 349 | °F |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0257.html |
| P2177 | Solubility | 0.0001 gram per 100 gram of solvent |  | 0.0001 | gram per 100 gram of solvent |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0257.html |
| P2404 | Time-weighted average exposure limit | 0.4 milligram per cubic metre |  | 0.4 | milligram per cubic metre |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0257.html |
| P233 | Canonical SMILES | CCOP(=S)(OCC)SCSP(=S)(OCC)OCC |  |  |  |  |  | normal | PubChem |
| P2067 | Mass | 383.988 Da |  | 383.988 | Da |  |  | normal | PubChem |
| P366 | Has use | insecticide | Q181322 |  |  |  |  | normal | Medical Subject Headings |
| P1552 | Has characteristic | Class IIIB combustible liquid | Q21009059 |  |  |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0257.html |
| P279 | Subclass of | chemical compound | Q11173 |  |  |  |  | normal |  |
| P3335 | Associated hazard | ethion exposure | Q21174259 |  |  |  |  | normal |  |
| P11931 | CAMEO Chemicals ID | 3365 |  |  |  |  |  | normal | https://cameochemicals.noaa.gov/chemical/3365 |
| P231 | CAS Registry Number | 563-12-2 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=563-12-2 |
| P683 | ChEBI ID | 38663 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:38663 |
| P592 | ChEMBL ID | CHEMBL1713417 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL1713417/ |
| P661 | ChemSpider ID | 3171 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.3171.html |
| P8494 | DSSTOX compound identifier | DTXCID204086 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID204086 |
| P3117 | DSSTox substance ID | DTXSID2024086 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID2024086 |
| P232 | EC number | 209-242-3 |  |  |  |  |  | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/209-242-3 |
| P2566 | ECHA Substance Infocard ID | 100.008.403 |  |  |  |  |  | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.008.403 |
| P646 | Freebase ID | /m/03vpl_ |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/03vpl_ |
| P7025 | HCIS ID | 1893 |  |  |  |  |  | normal | https://hcis.safeworkaustralia.gov.au/HazardousChemical/Details?chemicalID=1893 |
| P2062 | HSDB ID | 399 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/source/hsdb/399 |
| P2057 | Human Metabolome Database ID | HMDB0252018 |  |  |  |  |  | normal | https://www.hmdb.ca/metabolites/HMDB0252018 |
| P5220 | ICSC ID | 0888 |  |  |  |  |  | normal | https://chemicalsafety.ilo.org/dyn/icsc/showcard.display?p_card_id=0888 |
| P234 | InChI | InChI=1S/C9H22O4P2S4/c1-5-10-14(16,11-6-2)18-9-19-15(17,12-7-3)13-8-4/h5-9H2,1-4H3 |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C9H22O4P2S4/c1-5-10-14(16%2C11-6-2)18-9-19-15(17%2C12-7-3)13-8-4/h5-9H2%2C1-4H3 |
| P235 | InChIKey | RIZMRRKBZQXFOY-UHFFFAOYSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22RIZMRRKBZQXFOY-UHFFFAOYSA-N%22%5BInChIKey%5D |
| P665 | KEGG ID | C18725 |  |  |  |  |  | normal | https://www.kegg.jp/entry/C18725 |
| P2064 | KNApSAcK ID | C00062225 |  |  |  |  |  | normal | https://www.knapsackfamily.com/knapsack_core/information.php?sname=C_ID&word=C00062225 |
| P6689 | MassBank accession ID | SM847702 |  |  |  |  |  | normal | https://massbank.eu/MassBank/RecordDisplay?id=SM847702 |
| P486 | MeSH descriptor ID | C100038 |  |  |  |  |  | normal | https://meshb.nlm.nih.gov/record/ui?ui=C100038 |
| P6366 | Microsoft Academic ID (discontinued) | 2779041716 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2779041716 |
| P9405 | NMRShiftDB structure ID | 20208975 |  |  |  |  |  | normal | https://nmrshiftdb.nmr.uni-koeln.de/molecule/20208975 |
| P10283 | OpenAlex ID | C2779041716 |  |  |  |  |  | normal | https://openalex.org/C2779041716 |
| P12594 | OSHA Occupational Chemical Database ID | 411 |  |  |  |  |  | normal | https://www.osha.gov/chemicaldata/411 |
| P11949 | PesticideInfo chemical ID | PRI3063 |  |  |  |  |  | normal | https://www.pesticideinfo.org/chemical/PRI3063 |
| P11199 | Probes And Drugs ID | PD119052 |  |  |  |  |  | normal | https://www.probes-drugs.org/compound/PD119052 |
| P662 | PubChem CID | 3286 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/3286 |
| P1579 | Reaxys registry number | 1804530 |  |  |  |  |  | normal |  |
| P657 | RTECS number | TE4550000 |  |  |  |  |  | normal |  |
| P4964 | SPLASH | splash10-01ot-9700000000-ab9c668fa27781929a0f |  |  |  |  |  | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-01ot-9700000000-ab9c668fa27781929a0f') |
| P2877 | SureChEMBL ID | 26750 |  |  |  |  |  | normal | https://www.surechembl.org/chemical/26750 |
| P11089 | UniChem compound ID | 1015922 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=1015922 |
| P652 | UNII | 2TI07NO12Y |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/2TI07NO12Y |
| P679 | ZVG number | 510229 |  |  |  |  |  | normal | https://wikidata-externalid-url.toolforge.org/?p=679&url_prefix=https%3A%2F%2Fgestis.dguv.de%2Fdata%3Flang%3Den%26name%3D&id=510229 |

Source: https://aidb.si/e/ethion-Q414724 — Wikidata (CC0) via AIDb