# anthrone (Q411768)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P274 | Formula | C₁₄H₁₀O |  |  |  |  |  | normal | PubChem |
| P233 | Canonical SMILES | C1C2=CC=CC=C2C(=O)C3=CC=CC=C31 |  |  |  |  |  | normal | PubChem |
| P2067 | Mass | 194.073 Da |  | 194.073 | Da |  |  | normal | PubChem |
| P2101 | Melting point | 157°C |  | 157 | °C |  |  | normal | Jean-Claude Bradley Open Melting Point Dataset |
| P6185 | Tautomer of | 9-anthrol | Q18467079 |  |  |  |  | normal |  |
| P703 | Found in taxon | Aspergillus fumigatus | Q134359 |  |  |  |  | normal | Metabolomics of Aspergillus fumigatus |
| P279 | Subclass of | anthrone polyketide | Q109660056 |  |  |  |  | normal |  |
| P231 | CAS Registry Number | 90-44-8 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=90-44-8 |
| P683 | ChEBI ID | 33835 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:33835 |
| P592 | ChEMBL ID | CHEMBL124440 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL124440/ |
| P661 | ChemSpider ID | 6751 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.6751.html |
| P8494 | DSSTOX compound identifier | DTXCID0029391 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID0029391 |
| P3117 | DSSTox substance ID | DTXSID1049431 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID1049431 |
| P232 | EC number | 201-994-0 |  |  |  |  |  | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/201-994-0 |
| P2566 | ECHA Substance Infocard ID | 100.001.813 |  |  |  |  |  | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.001.813 |
| P646 | Freebase ID | /m/09fn15 |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/09fn15 |
| P1578 | Gmelin number | 875472 |  |  |  |  |  | normal |  |
| P2062 | HSDB ID | 2158 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2158 |
| P2057 | Human Metabolome Database ID | HMDB0248470 |  |  |  |  |  | normal | https://www.hmdb.ca/metabolites/HMDB0248470 |
| P4168 | IEDB Epitope ID | 116188 |  |  |  |  |  | normal | http://www.iedb.org/epitope/116188 |
| P234 | InChI | InChI=1S/C14H10O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-8H,9H2 |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C14H10O/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-8H%2C9H2 |
| P235 | InChIKey | RJGDLRCDCYRQOQ-UHFFFAOYSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22RJGDLRCDCYRQOQ-UHFFFAOYSA-N%22%5BInChIKey%5D |
| P2064 | KNApSAcK ID | C00063318 |  |  |  |  |  | normal | https://www.knapsackfamily.com/knapsack_core/information.php?sname=C_ID&word=C00063318 |
| P6689 | MassBank accession ID | SM802903 |  |  |  |  |  | normal | https://massbank.eu/MassBank/RecordDisplay?id=SM802903 |
| P6366 | Microsoft Academic ID (discontinued) | 2777213191 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2777213191 |
| P9405 | NMRShiftDB structure ID | 20041112 |  |  |  |  |  | normal | https://nmrshiftdb.nmr.uni-koeln.de/molecule/20041112 |
| P2840 | NSC number | 1965 |  |  |  |  |  | normal | https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=1965&Submit=Submit |
| P10283 | OpenAlex ID | C2777213191 |  |  |  |  |  | normal | https://openalex.org/C2777213191 |
| P662 | PubChem CID | 7018 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/7018 |
| P1579 | Reaxys registry number | 1910173 |  |  |  |  |  | normal |  |
| P4964 | SPLASH | splash10-0002-0900000000-d719a5e654e117cbb06a |  |  |  |  |  | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-0002-0900000000-d719a5e654e117cbb06a') |
| P2877 | SureChEMBL ID | 18143 |  |  |  |  |  | normal | https://www.surechembl.org/chemical/18143 |
| P11089 | UniChem compound ID | 390807 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=390807 |
| P652 | UNII | FP0FJ7K744 |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/FP0FJ7K744 |

Source: https://aidb.si/e/anthrone-Q411768 — Wikidata (CC0) via AIDb