# aldrin (Q409054) | Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources | | --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- | | P31 | Instance of | type of chemical entity | Q113145171 | | | | | normal | | | P274 | Formula | C₁₂H₈Cl₆ | | | | | | normal | PubChem | | P1931 | NIOSH Pocket Guide ID | 0016 | | | | | | normal | | | P2054 | Density | 1.6 g/cm³ | | 1.6 | g/cm³ | | | normal | http://www.cdc.gov/niosh/npg/npgd0016.html | | P1542 | Has effect | aldrin exposure | Q21167666 | | | | | normal | http://www.cdc.gov/niosh/npg/npgd0016.html | | P2129 | Immediately dangerous to life or health | 25 milligram per cubic metre | | 25 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh/npg/npgd0016.html | | P2101 | Melting point | 219°F | | 219 | °F | | | normal | http://www.cdc.gov/niosh/npg/npgd0016.html | | P2119 | Vapor pressure | 8e-5 millimetre of mercury | | 0.00008 | millimetre of mercury | | | normal | http://www.cdc.gov/niosh/npg/npgd0016.html | | P2177 | Solubility | 0.003 gram per 100 gram of solvent | | 0.003 | gram per 100 gram of solvent | | | normal | http://www.cdc.gov/niosh/npg/npgd0016.html | | P2404 | Time-weighted average exposure limit | 0.25 milligram per cubic metre | | 0.25 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh/npg/npgd0016.html \| http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_6 | | P2404 | Time-weighted average exposure limit | 0.5 milligram per cubic metre | | 0.5 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_6 | | P2404 | Time-weighted average exposure limit | 0.01 milligram per cubic metre | | 0.01 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_6 | | P2240 | Median lethal dose (LD50) | 20 milligram per cubic metre | | 20 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 3 milligram per cubic metre | | 3 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 90 milligram per cubic metre | | 90 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 5.8 milligram per cubic metre | | 5.8 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 4 milligram per kilogram | | 4 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 1,999 milligram per kilogram | | 1999 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 50 milligram per kilogram | | 50 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 150 milligram per kilogram | | 150 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 21 milligram per kilogram | | 21 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 10 milligram per kilogram | | 10 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 65 milligram per kilogram | | 65 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 520 milligram per kilogram | | 520 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 33 milligram per kilogram | | 33 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 100 milligram per kilogram | | 100 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 18 milligram per kilogram | | 18 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 56.2 milligram per kilogram | | 56.2 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 42.1 milligram per kilogram | | 42.1 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 50 milligram per kilogram | | 50 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 38 milligram per kilogram | | 38 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 7.2 milligram per kilogram | | 7.2 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 75 milligram per kilogram | | 75 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 15 milligram per kilogram | | 15 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 84 milligram per kilogram | | 84 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 98 milligram per kilogram | | 98 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 62 milligram per kilogram | | 62 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 40 milligram per kilogram | | 40 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2240 | Median lethal dose (LD50) | 39 milligram per kilogram | | 39 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_6 | | P2240 | Median lethal dose (LD50) | 44 milligram per kilogram | | 44 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_6 | | P2300 | Minimal lethal dose | 15 milligram per kilogram | | 15 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2300 | Minimal lethal dose | 1.25 milligram per kilogram | | 1.25 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2300 | Minimal lethal dose | 75 milligram per kilogram | | 75 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2300 | Minimal lethal dose | 100 milligram per kilogram | | 100 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2300 | Minimal lethal dose | 95 milligram per kilogram | | 95 | milligram per kilogram | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_3 | | P2300 | Minimal lethal dose | 5.8 milligram per cubic metre | | 5.8 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_6 | | P2407 | Short-term exposure limit | 0.75 milligram per cubic metre | | 0.75 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_6 | | P2407 | Short-term exposure limit | 1.5 milligram per cubic metre | | 1.5 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_6 | | P2407 | Short-term exposure limit | 0.03 milligram per cubic metre | | 0.03 | milligram per cubic metre | | | normal | http://www.cdc.gov/niosh-rtecs/IO200B20.html#modalIdString_CDCTable_6 | | P2868 | Subject has role | carcinogen | Q187661 | | | | | normal | https://oehha.ca.gov/chemicals/aldrin | | P2868 | Subject has role | neurotoxin | Q407752 | | | | | normal | | | P2868 | Subject has role | occupational carcinogen | Q21074597 | | | | | normal | http://www.cdc.gov/niosh/npg/npgd0016.html | | P4952 | Safety classification and labelling | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response | Q51139288 | | | | | normal | https://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=US&language=en&productNumber=36666&brand=SIAL&PageToGoToURL=https%3A%2F%2Fwww.sigmaaldrich.com%2Fcatalog%2Fproduct%2Fsial%2F36666%3Flang%3Dpl | | P1889 | Different from | octalene | Q27115546 | | | | | normal | | | P2017 | Isomeric SMILES | ClC4(Cl)[C@@]2(Cl)C(/Cl)=C(/Cl)[C@]4(Cl)[C@@H]3[C@@H]\1C[C@@H](/C=C/1)[C@H]23 | | | | | | normal | | | P2017 | Isomeric SMILES | C1[C@@H]2C=C[C@H]1[C@H]3[C@@H]2[C@]4(C(=C([C@@]3(C4(Cl)Cl)Cl)Cl)Cl)Cl | | | | | | normal | | | P366 | Has use | insecticide | Q181322 | | | | | normal | Medical Subject Headings | | P233 | Canonical SMILES | ClC1=C(Cl)C2(Cl)C3C4C=CC(C4)C3C1(Cl)C2(Cl)Cl | | | | | | normal | | | P527 | Members / parts | hydrogen | Q556 | | | | | normal | | | P527 | Members / parts | carbon | Q623 | | | | | normal | | | P527 | Members / parts | chlorine | Q688 | | | | | normal | | | P2067 | Mass | 361.8757 Da | | 361.875716336 | Da | | | normal | | | P3335 | Associated hazard | aldrin exposure | Q21167666 | | | | | normal | | | P279 | Subclass of | Aldrin parent | Q81984480 | | | | | normal | | | P138 | Named after | Kurt Alder | Q76595 | | | | | normal | | | P7524 | CA PROP 65 ID | aldrin | | | | | | normal | https://oehha.ca.gov/proposition-65/chemicals/aldrin | | P8072 | CAB ID | 17575 | | | | | | normal | https://www.cabi.org/cabithesaurus/mtwdk.exe?k=default&l=60&w=17575&s=5&t=2 | | P11931 | CAMEO Chemicals ID | 4853 | | | | | | normal | https://cameochemicals.noaa.gov/chemical/4853 | | P231 | CAS Registry Number | 309-00-2 | | | | | | normal | https://commonchemistry.cas.org/detail?cas_rn=309-00-2 | | P6852 | CCDC Number | 1102218 | | | | | | normal | https://identifiers.org/ccdc:1102218 | | P683 | ChEBI ID | 2564 | | | | | | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:2564 | | P661 | ChemSpider ID | 10292747 | | | | | | normal | https://www.chemspider.com/Chemical-Structure.10292747.html | | P11375 | CSD Refcode | ALDRIN | | | | | | normal | https://identifiers.org/csd:ALDRIN | | P8494 | DSSTOX compound identifier | DTXCID10819882 | | | | | | normal | https://comptox.epa.gov/dashboard/DTXCID10819882 | | P3117 | DSSTox substance ID | DTXSID8020040 | | | | | | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID8020040 | | P232 | EC number | 206-215-8 | | | | | | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/206-215-8 | | P2566 | ECHA Substance Infocard ID | 100.005.652 | | | | | | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.005.652 | | P1417 | Encyclopædia Britannica Online ID | science/aldrin | | | | | | normal | https://www.britannica.com/science/aldrin | | P646 | Freebase ID | /m/06x_4m | | | | | | normal | https://www.google.com/search?kgmid=/m/06x_4m | | P12385 | Gran Enciclopèdia Catalana ID | aldrin | | | | | | normal | https://www.enciclopedia.cat/gran-enciclopedia-catalana/aldrin | | P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0076528 | | | | | | normal | https://www.enciclopedia.cat/ec-gec-0076528.xml | | P4342 | Great Norwegian Encyclopedia ID | aldrin | | | | | | normal | https://wikidata-externalid-url.toolforge.org/?p=4342&url_prefix=https://snl.no/&id=aldrin | | P7025 | HCIS ID | 107 | | | | | | normal | https://hcis.safeworkaustralia.gov.au/HazardousChemical/Details?chemicalID=107 | | P2062 | HSDB ID | 199 | | | | | | normal | https://pubchem.ncbi.nlm.nih.gov/source/hsdb/199 | | P5220 | ICSC ID | 0774 | | | | | | normal | https://chemicalsafety.ilo.org/dyn/icsc/showcard.display?p_card_id=0774 | | P234 | InChI | InChI=1S/C12H8Cl6/c13-8-9(14)11(16)7-5-2-1-4(3-5)6(7)10(8,15)12(11,17)18/h1-2,4-7H,3H2/t4-,5+,6+,7-,10+,11- | | | | | | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C12H8Cl6/c13-8-9(14)11(16)7-5-2-1-4(3-5)6(7)10(8%2C15)12(11%2C17)18/h1-2%2C4-7H%2C3H2/t4-%2C5%2B%2C6%2B%2C7-%2C10%2B%2C11- | | P235 | InChIKey | QBYJBZPUGVGKQQ-SJJAEHHWSA-N | | | | | | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22QBYJBZPUGVGKQQ-SJJAEHHWSA-N%22%5BInChIKey%5D | | P665 | KEGG ID | C07552 | | | | | | normal | https://www.kegg.jp/entry/C07552 | | P8313 | Lex ID | aldrin | | | | | | normal | https://wikidata-externalid-url.toolforge.org/?p=8313&url_prefix=https://lex.dk/&id=aldrin | | P6689 | MassBank accession ID | MSBNK-MSSJ-MSJ01082 | | | | | | normal | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-MSSJ-MSJ01082 | | P486 | MeSH descriptor ID | D000452 | | | | | | normal | https://meshb.nlm.nih.gov/record/ui?ui=D000452 | | P672 | MeSH tree code | D02.455.526.439.042 | | | | | | normal | https://id.nlm.nih.gov/mesh/D02.455.526.439.042 | | P6366 | Microsoft Academic ID (discontinued) | 2781032171 | | | | | | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2781032171 | | P2840 | NSC number | 8937 | | | | | | normal | https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=8937&Submit=Submit | | P10283 | OpenAlex ID | C2781032171 | | | | | | normal | https://openalex.org/C2781032171 | | P12594 | OSHA Occupational Chemical Database ID | 349 | | | | | | normal | https://www.osha.gov/chemicaldata/349 | | P11949 | PesticideInfo chemical ID | PRI867 | | | | | | normal | https://www.pesticideinfo.org/chemical/PRI867 | | P662 | PubChem CID | 12310947 | | | | | | normal | https://pubchem.ncbi.nlm.nih.gov/compound/12310947 | | P657 | RTECS number | IO2100000 | | | | | | normal | | | P2877 | SureChEMBL ID | 18376 | | | | | | normal | https://www.surechembl.org/chemical/18376 | | P4527 | UK Parliament thesaurus ID | 8300 | | | | | | normal | https://lda.data.parliament.uk/terms/8300.html | | P695 | UN number | 2761 | | | | | | normal | https://cameochemicals.noaa.gov/unna/2761 | | P11089 | UniChem compound ID | 12561608 | | | | | | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=12561608 | | P652 | UNII | OZE3CLY605 | | | | | | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/OZE3CLY605 | | P13204 | Wellcome Collection concept ID | qvepzh53 | | | | | | normal | https://wellcomecollection.org/concepts/qvepzh53 | | P679 | ZVG number | 510027 | | | | | | normal | https://wikidata-externalid-url.toolforge.org/?p=679&url_prefix=https%3A%2F%2Fgestis.dguv.de%2Fdata%3Flang%3Den%26name%3D&id=510027 | Source: https://aidb.si/e/aldrin-Q409054 — Wikidata (CC0) via AIDb