# D-(-)-mannitol (Q407646) | Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources | | --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- | | P31 | Instance of | type of chemical entity | Q113145171 | | | | | normal | | | P274 | Formula | C₆H₁₄O₆ | | | | | | normal | PubChem | | P2175 | Medical condition treated | anuria | Q612681 | | | | | normal | NDF-RT | | P2175 | Medical condition treated | oliguria | Q961326 | | | | | normal | NDF-RT | | P2175 | Medical condition treated | ocular hypertension | Q9294051 | | | | | normal | NDF-RT | | P2175 | Medical condition treated | cerebral edema | Q979168 | | | | | normal | NDF-RT | | P2017 | Isomeric SMILES | C([C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)O | | | | | | normal | PubChem | | P233 | Canonical SMILES | C(C(C(C(C(CO)O)O)O)O)O | | | | | | normal | PubChem | | P2067 | Mass | 182.079 Da | | 182.079 | Da | | | normal | PubChem | | P3489 | Pregnancy category | US pregnancy category C | Q28123617 | | | | | normal | | | P3780 | Active ingredient in | Bronchitol | Q29004927 | | | | | normal | http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/001252/human_med_001475.jsp | | P3780 | Active ingredient in | Osmitrol | Q47521945 | | | | | normal | RxNorm | | P4250 | Defined daily dose | 0.8 g | | 0.8 | g | | | normal | https://www.whocc.no/atc_ddd_index/?code=R05CB16 | | P2868 | Subject has role | osmotic diuretics | Q50429975 | | | | | normal | Medical Subject Headings | | P2868 | Subject has role | WHO essential medicines | Q35456 | | | | | normal | | | P2101 | Melting point | 166°C | | 166 | °C | | | normal | Jean-Claude Bradley Open Melting Point Dataset | | P361 | Part of | mannitol dehydrogenase activity | Q22319077 | | | | | normal | Gene Ontology release 2020-05-02 | | P361 | Part of | mannitol-1-phosphatase activity | Q22320271 | | | | | normal | Gene Ontology release 2020-05-02 | | P361 | Part of | mannitol 2-dehydrogenase (NADP+) activity | Q22318380 | | | | | normal | Gene Ontology release 2020-05-02 | | P361 | Part of | mannitol 2-dehydrogenase activity | Q22318386 | | | | | normal | Gene Ontology release 2020-05-02 | | P361 | Part of | D-mannitol oxidase activity | Q22318266 | | | | | normal | Gene Ontology release 2020-05-02 | | P361 | Part of | mannitol dehydrogenase (cytochrome) activity | Q22318327 | | | | | normal | http://geneontology.org/external2go/rhea2go | | P366 | Has use | food additive | Q189567 | | | | | normal | | | P366 | Has use | sweetener | Q3400794 | | | | | normal | Medical Subject Headings | | P703 | Found in taxon | Tamilnadia uliginosa | Q15454747 | | | | | normal | Coumarins from the Bark of Amyris lineata | | P703 | Found in taxon | Pavetta indica | Q13113941 | | | | | normal | Constituents of Melia indica leaves | | P703 | Found in taxon | Jasminum azoricum | Q5486345 | | | | | normal | DETERMINATION OF IRIDOIDS, FLAVONOIDS AND MANNITOL IN JASMINS GROWING IN EGYPT | | P703 | Found in taxon | Jasminum fluminense | Q17713049 | | | | | normal | DETERMINATION OF IRIDOIDS, FLAVONOIDS AND MANNITOL IN JASMINS GROWING IN EGYPT | | P703 | Found in taxon | Jasminum sambac | Q1356614 | | | | | normal | DETERMINATION OF IRIDOIDS, FLAVONOIDS AND MANNITOL IN JASMINS GROWING IN EGYPT | | P703 | Found in taxon | Aegiceras corniculatum | Q4320452 | | | | | normal | Chemical Composition of Australian Mangroves II. Low Molecular Weight Carbohydrates | | P703 | Found in taxon | Lumnitzera littorea | Q12237648 | | | | | normal | Chemical Composition of Australian Mangroves II. Low Molecular Weight Carbohydrates | | P703 | Found in taxon | Lumnitzera racemosa | Q3840611 | | | | | normal | Chemical Composition of Australian Mangroves II. Low Molecular Weight Carbohydrates | | P703 | Found in taxon | Sonneratia alba | Q1150684 | | | | | normal | Chemical Composition of Australian Mangroves II. Low Molecular Weight Carbohydrates | | P703 | Found in taxon | Scyphiphora hydrophyllacea | Q104249507 | | | | | normal | Chemical Composition of Australian Mangroves II. Low Molecular Weight Carbohydrates | | P703 | Found in taxon | Vaccinium oxycoccos | Q374399 | | | | | normal | A QUANTITATIVE STUDY OF MANNITOL, SORBITOL, XYLITOL, AND XYLOSE IN WILD BERRIES AND COMMERCIAL FRUITS | | P703 | Found in taxon | Rubus idaeus | Q12252383 | | | | | normal | A QUANTITATIVE STUDY OF MANNITOL, SORBITOL, XYLITOL, AND XYLOSE IN WILD BERRIES AND COMMERCIAL FRUITS | | P703 | Found in taxon | Sorbus aucuparia | Q146198 | | | | | normal | A QUANTITATIVE STUDY OF MANNITOL, SORBITOL, XYLITOL, AND XYLOSE IN WILD BERRIES AND COMMERCIAL FRUITS | | P703 | Found in taxon | Rehmannia glutinosa | Q1071605 | | | | | normal | [Chemical studies on crude drug processing. X. On the constituents of rehmanniae radix (4): comparison of the constituents of various rehmanniae radixes originating in China, Korea, and Japan] \| Studies on the Constituent of Plants of Genus Pedicularis, Veronicastrum and Veronica (Scrophulariaceae) | | P703 | Found in taxon | straw mushroom | Q641656 | | | | | normal | Flavor Compounds in Straw MushroomsVolvariellavolvaceaHarvested at Different Stages of Maturity | | P703 | Found in taxon | Acanthospermum hispidum | Q4672044 | | | | | normal | Plant-derived sweetening agents: saccharide and polyol constituents of some sweet-tasting plants | | P703 | Found in taxon | Inga spectabilis | Q1526713 | | | | | normal | Plant-derived sweetening agents: saccharide and polyol constituents of some sweet-tasting plants | | P703 | Found in taxon | Stereocaulon ramulosum | Q21321251 | | | | | normal | Isolation and identification of a linear (1→3)-linked β-d-glucan and other carbohydrate components of the lichen Stereocaulon ramulosum (SW.) Räusch | | P703 | Found in taxon | Cajanus cajan | Q632559 | | | | | normal | Analysis of phenolic acids and carbohydrates in pigeon pea (Cajanus cajan) plant | | P703 | Found in taxon | Evernia prunastri | Q904074 | | | | | normal | High-performance liquid chromatographic determination of sugars and polyols in extracts of lichens and sugarcane juice | | P703 | Found in taxon | Himantormia lugubris | Q21271209 | | | | | normal | High-performance liquid chromatographic determination of sugars and polyols in extracts of lichens and sugarcane juice | | P703 | Found in taxon | Podanthus mitiqui | Q15594005 | | | | | normal | SOME CONSTITUENTS OF VIOLET LEAVES. | | P703 | Found in taxon | Ramalina fraxinea | Q309630 | | | | | normal | Chemical composition of the Ramalina fraxinea (L.) Ach. thallus | | P703 | Found in taxon | Ophiocordyceps sinensis | Q398300 | | | | | normal | Medicinal Value of Cordyceps sinensis \| Anti-inflammatory Principles from Cordyceps sinensis | | P703 | Found in taxon | Licaria aurea | Q15611312 | | | | | normal | Neolignans from Licaria aurea | | P703 | Found in taxon | Allium tuberosum | Q42285 | | | | | normal | A steroidal saponin from the seeds of Allium tuberosum | | P703 | Found in taxon | Cinnamosma fragrans | Q17243958 | | | | | normal | Cinnafragrins A-C, dimeric and trimeric drimane sesquiterpenoids from Cinnamosma fragrans, and structure revision of capsicodendrin | | P703 | Found in taxon | Cinnamosma madagascariensis | Q17244922 | | | | | normal | Secondary metabolites of Cinnamosma madagascariensis and their alpha-glucosidase inhibitory properties | | P703 | Found in taxon | Cistanche tubulosa | Q15239902 | | | | | normal | Monoterpene constituents from Cistanche tubulosa--chemical structures of kankanosides A-E and kankanol- | | P703 | Found in taxon | Tarenna gracilipes | Q15245541 | | | | | normal | Tareciliosides A--G: Cycloartane glycosides from leaves of Tarenna gracilipes (HAY.) OHWI. | | P703 | Found in taxon | Ammi majus | Q133477 | | | | | normal | Coumarins and coumarin glucosides from the fruits of Ammi majus | | P703 | Found in taxon | Eleutherococcus giraldii | Q11127543 | | | | | normal | Chemical constituents from Acanthopanax brachypus | | P703 | Found in taxon | Agaricus xanthodermus | Q1349044 | | | | | normal | The Chemistry and Antibiotic Activity of the ToadstoolAgaricus xanthoderma (Agaricales) | | P703 | Found in taxon | Alaria angusta | Q29347887 | | | | | normal | The structure and13C NMR spectra of mannitol oligo-β-d-glucopyranosides isolated from the brown seaweedChorda filum (L.) Lam | | P703 | Found in taxon | Alternaria cucumerina | Q18353391 | | | | | normal | Identification of some metabolites of Alternaria cucumerina (E. & E.) Ell. | | P703 | Found in taxon | Aralia decaisneana | Q11174629 | | | | | normal | Study on chemical constituents of Inula cappa | | P703 | Found in taxon | Arisaema amurense | Q4069209 | | | | | normal | Studies on chemical constituents of Rabdosia serra | | P703 | Found in taxon | Ascophyllum nodosum | Q1415896 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds \| L-3,4-Dihydroxyphenylalanine-3-Sulfate From the Brown Alga, Ascophyllum nodosum | | P703 | Found in taxon | Ascoseira mirabilis | Q21397835 | | | | | normal | Carbohydrates of the antarctic brown seaweed Ascoseira mirabilis | | P703 | Found in taxon | Aspergillus niger | Q132014 | | | | | normal | A new fatty acid methyl ester and other biologically active compounds from Aspergillus niger | | P703 | Found in taxon | Aspergillus quadrilineatus | Q59504762 | | | | | normal | A New Metabolite from Aspergillus quadrilineatus | | P703 | Found in taxon | Bifurcaria bifurcata | Q21154431 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Brandisia hancei | Q11099962 | | | | | normal | Brandioside, a phenylpropanoid glycoside from Brandisia hancei | | P703 | Found in taxon | Buddleja officinalis | Q4984693 | | | | | normal | Marrying structure and genomics | | P703 | Found in taxon | Buddleja scordioides | Q4984711 | | | | | normal | Triterpenoid saponins and other glycosides from Buddleja scordioides | | P703 | Found in taxon | Canella winterana | Q2706419 | | | | | normal | 3β,9α-Dihydroxycinnamolide: A Further Novel Drimane Sesquiterpene from the Stem Bark of Canella winterana | | P703 | Found in taxon | Psydrax subcordatus | Q15435259 | | | | | normal | Investigations on West African medicinal plants | | P703 | Found in taxon | Carum carvi | Q26811 | | | | | normal | Water-soluble constituents of caraway: aromatic compound, aromatic compound glucoside and glucides | | P703 | Found in taxon | Chiococca alba | Q5101397 | | | | | normal | Ketoalcohols, lignans and coumarins from Chiococca alba | | P703 | Found in taxon | Chorda filum | Q117405 | | | | | normal | The structure and13C NMR spectra of mannitol oligo-β-d-glucopyranosides isolated from the brown seaweedChorda filum (L.) Lam | | P703 | Found in taxon | Cistanche salsa | Q15239278 | | | | | normal | Studies on the constituents of Cistanchis Herba. II. Isolation and structures of new iridoids, cistanin and cistachlorin. | | P703 | Found in taxon | Cladonia convoluta | Q3678854 | | | | | normal | Cytotoxic activity of compounds from the lichen: Cladonia convoluta. | | P703 | Found in taxon | Cladonia foliacea | Q887020 | | | | | normal | Cytotoxic activity of compounds from the lichen: Cladonia convoluta. | | P703 | Found in taxon | Cladonia sandstedei | Q10454232 | | | | | normal | The Utilization of Urea by the Lichen Cladonia sandstedei | | P703 | Found in taxon | Cladostephus spongiosus var. verticillatus | Q104992798 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Cnidium monnieri | Q12842240 | | | | | normal | Glucides of Cnidium monnieri fruit | | P703 | Found in taxon | Cocos nucifera | Q13187 | | | | | normal | Generation of Mannitol from Copra Meal | | P703 | Found in taxon | Coriandrum sativum | Q41611 | | | | | normal | Water-soluble constituents of coriander | | P703 | Found in taxon | Cuminum cyminum | Q132624 | | | | | normal | Sesquiterpene lactone glucosides and alkyl glycosides from the fruit of cumin | | P703 | Found in taxon | Cuphea carthagenensis | Q10891006 | | | | | normal | Chemical Components of Cuphea Species. Carthagenol: A New Triterpene from C. carthagenensis | | P703 | Found in taxon | Cuphea epilobiifolia | Q15528089 | | | | | normal | Chemical Components of Cuphea Species. Carthagenol: A New Triterpene from C. carthagenensis | | P703 | Found in taxon | Cuphea wrightii | Q15474223 | | | | | normal | Triterpenes and flavonoid glycosides from Cuphea wrightii | | P703 | Found in taxon | Cystoseira barbata | Q4505908 | | | | | normal | The structure and13C NMR spectra of mannitol oligo-β-d-glucopyranosides isolated from the brown seaweedChorda filum (L.) Lam | | P703 | Found in taxon | Cystoseira crinita | Q29244694 | | | | | normal | The structure and13C NMR spectra of mannitol oligo-β-d-glucopyranosides isolated from the brown seaweedChorda filum (L.) Lam | | P703 | Found in taxon | Cystoseira foeniculacea | Q22695197 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Delphinium dzavakhischwilii | Q15371800 | | | | | normal | D-mannitol from Peucedanum and Delphinium | | P703 | Found in taxon | Delphinium freynii | Q50839849 | | | | | normal | D-mannitol from Peucedanum and Delphinium | | P703 | Found in taxon | Dictyota dichotoma | Q2154615 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Dystaenia takeshimana | Q104384235 | | | | | normal | Chemical constituents of the root of Dystaenia takeshimana and their anti-inflammatory activity | | P703 | Found in taxon | Endarachne binghamiae | Q104992800 | | | | | normal | Chemical Constituents of Endarachne binghamiae (Scytosiphonales, Phaeophyta) from the Karachi Coast | | P703 | Found in taxon | Euphorbia plumerioides | Q5851852 | | | | | normal | Ent-14[S],16β,17-trihydroxyatisan-3-one and further constituents from Euphorbia fidjiana | | P703 | Found in taxon | Foeniculum vulgare | Q43511 | | | | | normal | Water-Soluble Constituents of Fennel. IX. Glucides and Nucleosides. | | P703 | Found in taxon | Fraxinus floribunda | Q5494014 | | | | | normal | Coumarins from Fraxinus floribunda leaves | | P703 | Found in taxon | Fraxinus raibocarpa | Q21398910 | | | | | normal | Flavonoids of Fraxinus raibocarpa | | P703 | Found in taxon | Fucus serratus | Q1506400 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Fucus spiralis | Q1934508 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Fucus vesiculosus | Q754755 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Ganoderma lucidum | Q271098 | | | | | normal | The biologically active constituents of Ganoderma lucidum (Fr.) Karst. Histamine release-inhibitory triterpenes | | P703 | Found in taxon | Gardenia erubescens | Q1494088 | | | | | normal | Pharmacological Effects of Gardenia erubescens in Mice, Rats and Cats | | P703 | Found in taxon | Gardenia jasminoides | Q1072101 | | | | | normal | Stimulants from Gardeniae Fructus for Cultured Endothelial Cell Proliferation | | P703 | Found in taxon | Genipa americana | Q1353278 | | | | | normal | Inhaltsstoffe aus Genipa americana (Rubiaceae): Mannit | | P703 | Found in taxon | Phyllanthus velutinus | Q104846067 | | | | | normal | Triterpenoids from Glochidion heyneanum* | | P703 | Found in taxon | Himanthalia elongata | Q1636443 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Hohenbuehelia serotina | Q104838342 | | | | | normal | Chemical Constituents of a Heat-dried Chinese Mushroom,Hohenbuehelia serotina | | P703 | Found in taxon | Laggera pterodonta | Q15231544 | | | | | normal | Eleven New Eudesmane Derivatives fromLaggerapterodonta | | P703 | Found in taxon | Laminaria digitata | Q1093337 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Saccharina latissima | Q228105 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Ligustrum obtusifolium | Q1069783 | | | | | normal | Studies on the Constituents of Ligustrum Species. IX. On the Components of the Fruits of Ligustrum obtusifolium SIEB. et ZUCC. (3) | | P703 | Found in taxon | Morinda citrifolia | Q234238 | | | | | normal | Chemical constituents of the fruits of Morinda citrifolia (Noni) and their antioxidant activity. \| Chemical Constituents of the Fruits of Morinda citrifolia (Noni) and Their Antioxidant Activity \| Chemical Constituents of the Fruits of Morinda citrifolia (Noni) and Their Antioxidant Activity | | P703 | Found in taxon | Nierembergia hippomanica | Q15531903 | | | | | normal | 7,8-dihydroajugasterone C, norhygrine and other constituents of Nierembergia hippomanica | | P703 | Found in taxon | Nierembergia linariifolia | Q2245583 | | | | | normal | 7,8-dihydroajugasterone C, norhygrine and other constituents of Nierembergia hippomanica | | P703 | Found in taxon | Olea verrucosa | Q104992808 | | | | | normal | Components of the leaves ofOlea verrucosa | | P703 | Found in taxon | Osmanthus × fortunei | Q5963924 | | | | | normal | Studies on the Constituents of Osmanthus Species. IV. On the Components of the Leaves of Osmanthus fortunei CARR. | | P703 | Found in taxon | Osmanthus ilicifolius | Q87636172 | | | | | normal | Studies on the Constituents of Osmanthus Species. III. On the Components of the Leaves of Osmanthus ilicifolius (HASSK.) MOUILLEFERT | | P703 | Found in taxon | Padina antillarum | Q29890162 | | | | | normal | Carbohydrates of Padina tetrastromatica | | P703 | Found in taxon | Padina tetrastromatica | Q29890201 | | | | | normal | Carbohydrates of Padina tetrastromatica | | P703 | Found in taxon | Paxillus involutus | Q518069 | | | | | normal | A New Phenolic Metabolite, Involutone, Isolated from the Mushroom Paxillus involutus. | | P703 | Found in taxon | Pedicularis chamissonis | Q17715519 | | | | | normal | Studies on the Constituent of Plants of Genus Pedicularis, Veronicastrum and Veronica (Scrophulariaceae) | | P703 | Found in taxon | Pedicularis muscicola | Q15231130 | | | | | normal | Chemical Constituents of Pedicularis densispica Franch | | P703 | Found in taxon | channelled wrack | Q1669623 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Talaromyces verruculosus | Q104084151 | | | | | normal | Isolation and identification of vermistatin, ergosterol, stearic acid and mannitol, metabolic products of Penicillium verruculosum | | P703 | Found in taxon | Peucedanum mashanense | Q15231983 | | | | | normal | Chemical constituents of Peucedanum japonicum roots | | P703 | Found in taxon | Pimpinella anisum | Q28692 | | | | | normal | Aromatic compound glucosides, alkyl glucoside and glucide from the fruit of anise | | P703 | Found in taxon | Pisolithus arhizus | Q1315936 | | | | | normal | Triterpenoids of the fungus Pisolithus tinctorius* | | P703 | Found in taxon | Pisolithus tinctorius | Q103817344 | | | | | normal | Triterpenoids of the fungus Pisolithus tinctorius* | | P703 | Found in taxon | Deverra tortuosa | Q15571499 | | | | | normal | New ester and furocoumarins from the roots of Pituranthos tortuosus | | P703 | Found in taxon | Pleurotus ostreatus | Q186451 | | | | | normal | Studies on constituent of edible fungi. Part II. Chemical constituents of Pleurotus ostreatus. | | P703 | Found in taxon | Poa annua | Q157571 | | | | | normal | Luteolin 6-C-β-ristobioside from Poa annua | | P703 | Found in taxon | pomegranate | Q13188 | | | | | normal | Punicafolin, an ellagitannin from the leaves of Punica granatum \| Elucidating the role of shikimate dehydrogenase in controlling the production of anthocyanins and hydrolysable tannins in the outer peels of pomegranate | | P703 | Found in taxon | Oxyceros horridus | Q13013812 | | | | | normal | Phytochemical study onRandia siamensis | | P703 | Found in taxon | Himalrandia tetrasperma | Q15460497 | | | | | normal | Chemical constituents of Randia tetrasperma | | P703 | Found in taxon | Rothmannia longiflora | Q11191948 | | | | | normal | 4-Oxonicotinamide-1-(1′-β-?-ribofuranoside) from Rothmannia longiflora Salisb. (Rubiaceae) | | P703 | Found in taxon | Saccorhiza polyschides | Q310345 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Salsola collina | Q15226213 | | | | | normal | Carbohydrates, carbohydrate ethers, and alcohols of Salsola collina | | P703 | Found in taxon | Salvia deserta | Q4519771 | | | | | normal | Chemical Constituents of Salvia aegyptiaca | | P703 | Found in taxon | Saposhnikovia divaricata | Q5100860 | | | | | normal | Chemical constituents of roots of Saposhnikovia divaricata | | P703 | Found in taxon | Sargassum muticum | Q287682 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Schumanniophyton magnificum | Q15448064 | | | | | normal | New Chromone Alkaloids from the Stem Bark of Schumanniophyton magnificum | | P703 | Found in taxon | Scoparia dulcis | Q7787299 | | | | | normal | Genetic Transformation of Scoparia dulcis L. | | P703 | Found in taxon | Seseli foliosum | Q17133029 | | | | | normal | Coumarins ofSeseli foliosum | | P703 | Found in taxon | Seseli | Q592341 | | | | | normal | Coumarins of Seseli krylovii | | P703 | Found in taxon | Sphaerotrichia divaricata | Q29674259 | | | | | normal | The structure and13C NMR spectra of mannitol oligo-β-d-glucopyranosides isolated from the brown seaweedChorda filum (L.) Lam | | P703 | Found in taxon | Halopteris | Q4009419 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Stypocaulon | Q104713721 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Torilis japonica | Q1468770 | | | | | normal | New Hemiterpenoid Pentol and Monoterpenoid Glycoside of Torillis japonica Fruit, and Consideration of the Origin of Apiose. | | P703 | Found in taxon | Veronica japonensis | Q16269383 | | | | | normal | Studies on the Constituent of Plants of Genus Pedicularis, Veronicastrum and Veronica (Scrophulariaceae) | | P703 | Found in taxon | Veronica kiusiana | Q15250718 | | | | | normal | Studies on the Constituent of Plants of Genus Pedicularis, Veronicastrum and Veronica (Scrophulariaceae) | | P703 | Found in taxon | Veronicastrum sibiricum | Q5353042 | | | | | normal | Studies on the Constituent of Plants of Genus Pedicularis, Veronicastrum and Veronica (Scrophulariaceae) | | P703 | Found in taxon | Catunaregam spinosa | Q11046535 | | | | | normal | Triterpenoids from Randia dumetorum \| 2D NMR Structure Elucidation of a New Coumarin Glycoside from Xeromphis spinosa | | P703 | Found in taxon | Escherichia coli | Q25419 | | | | | normal | A comprehensive genome-scale reconstruction of Escherichia coli metabolism--2011. \| Reversal of the mannitol-sorbitol diauxie in Escherichia coli. \| Phosphorylation of D-glucose in Escherichia coli mutants defective in glucosephosphotransferase, mannosephosphotransferase, and glucokinase \| Mutations affecting transport of the hexitols D-mannitol, D-glucitol, and galactitol in Escherichia coli K-12: isolation and mapping | | P703 | Found in taxon | Veronica lavaudiana | Q17744857 | | | | | normal | Iridoid and phenylethanoid glucosides from Veronica lavaudiana | | P703 | Found in taxon | Cordiera sessilis | Q15477215 | | | | | normal | A new antifungal phenolic glycoside derivative, iridoids and lignans from Alibertia sessilis (vell.) k. schum. (Rubiaceae) | | P703 | Found in taxon | Streptomyces filamentosus | Q22285259 | | | | | normal | Roseosporol A, the first isolation of a novel sesquiterpenoid from Streptomyces roseosporus | | P703 | Found in taxon | Campylanthus salsoloides | Q15349038 | | | | | normal | Iridoid glucosides and caffeoyl phenylethanoid glycosides from Campylanthus salsaloides and Campylanthus glaber | | P703 | Found in taxon | Delphinium schmalhausenii | Q15373074 | | | | | normal | D-mannitol from Peucedanum and Delphinium | | P703 | Found in taxon | Ishige okamurae | Q21170251 | | | | | normal | Study on chemical constituents of Achillea alpina | | P703 | Found in taxon | Murraya paniculata | Q238591 | | | | | normal | Metabolomic comparative analysis of the phloem sap of curry leaf tree (Bergera koenegii), orange jasmine (Murraya paniculata), and Valencia sweet orange (Citrus sinensis) supports their differential responses to Huanglongbing. | | P703 | Found in taxon | Hedophyllum bongardianum | Q68486422 | | | | | normal | The structure and13C NMR spectra of mannitol oligo-β-d-glucopyranosides isolated from the brown seaweedChorda filum (L.) Lam | | P703 | Found in taxon | Saccharina cichorioides | Q20923500 | | | | | normal | The structure and13C NMR spectra of mannitol oligo-β-d-glucopyranosides isolated from the brown seaweedChorda filum (L.) Lam | | P703 | Found in taxon | Emericella desertorum | Q10482178 | | | | | normal | Studies on fungal products. Part 10. Isolation and structures of novel bicoumarins, desertorins A, B, and C, from Emericella desertorum | | P703 | Found in taxon | Cannabis sativa | Q26726 | | | | | normal | Constituents of Cannabis sativa L. XVII. A review of the natural constituents | | P703 | Found in taxon | Olea europaea | Q37083 | | | | | normal | Sugar and polyol compositions of some European olive fruit varieties (Olea europaea L.) suitable for table olive purposes \| Stachyose and mannitol transport in olive (Olea europaea L.) | | P703 | Found in taxon | Laminaria saccharina | Q104249344 | | | | | normal | Sorbitol and sorbitol phosphate in brown seaweeds | | P703 | Found in taxon | Apium graveolens | Q28298 | | | | | normal | Phytochemical and biological characterization of Italian "sedano bianco di Sperlonga" Protected Geographical Indication celery ecotype: A multimethodological approach \| The Anti-inflammatory Activity of Celery Apium graveolens L. (Fam. Umbelliferae) | | P703 | Found in taxon | Ruta graveolens | Q25062 | | | | | normal | Enhanced in vitro production of Ruta graveolens L. coumarins and rutin by mannitol and ventilation | | P703 | Found in taxon | tomato | Q23501 | | | | | normal | Metabolic changes in fruits of the tomato dx mutant | | P703 | Found in taxon | Isaria cicadae | Q10536893 | | | | | normal | Chemical Constituents of Cordyceps cicadae | | P703 | Found in taxon | Osmanthus heterophyllus | Q2364246 | | | | | normal | Studies on the Constituents of Osmanthus Species. III. On the Components of the Leaves of Osmanthus ilicifolius (HASSK.) MOUILLEFERT | | P703 | Found in taxon | Scyphiphora hydrophylacea | Q3543585 | | | | | normal | Chemical Composition of Australian Mangroves II. Low Molecular Weight Carbohydrates | | P703 | Found in taxon | Laggera crispata | Q15548177 | | | | | normal | Eleven New Eudesmane Derivatives fromLaggerapterodonta | | P703 | Found in taxon | Cistanche phelypaea | Q15350429 | | | | | normal | Monoterpene constituents from Cistanche tubulosa--chemical structures of kankanosides A-E and kankanol- | | P703 | Found in taxon | Siraitia grosvenorii | Q1544966 | | | | | normal | Plant-derived sweetening agents: saccharide and polyol constituents of some sweet-tasting plants | | P703 | Found in taxon | Cuphea appendiculata | Q15527839 | | | | | normal | Chemical Components of Cuphea Species. Carthagenol: A New Triterpene from C. carthagenensis | | P703 | Found in taxon | Inonotus obliquus | Q1956937 | | | | | normal | Studies on chemical constituents of Rabdosia serra | | P703 | Found in taxon | Nectandra hihua | Q15610163 | | | | | normal | Lignoids from Nectandra amazonum and N. glabrescens | | P703 | Found in taxon | Scrophulariaceae | Q53473 | | | | | normal | Studies on the Constituent of Plants of Genus Pedicularis, Veronicastrum and Veronica (Scrophulariaceae) | | P703 | Found in taxon | Salvia deserti | Q15359035 | | | | | normal | Chemical Constituents of Salvia aegyptiaca | | P703 | Found in taxon | Sarcomyxa serotina | Q81202193 | | | | | normal | Chemical Constituents of a Heat-dried Chinese Mushroom,Hohenbuehelia serotina | | P176 | Manufacturer | Pfizer | Q206921 | | | | | normal | https://www.pfizer.com/products/product-list | | P279 | Subclass of | carbohydrate | Q11358 | | | | | normal | | | P279 | Subclass of | mannitol | Q75079467 | | | | | normal | | | P3493 | Legal status (medicine) | boxed warning | Q879952 | | | | | normal | https://nctr-crs.fda.gov/fdalabel/ui/spl-summaries/criteria/343802 | | P3364 | Stereoisomer of | L-mannitol | Q27117350 | | | | | normal | | | P3364 | Stereoisomer of | D-sorbitol | Q245280 | | | | | normal | | | P3364 | Stereoisomer of | L-Talitol | Q82148149 | | | | | normal | | | P3364 | Stereoisomer of | D-altritol | Q27466520 | | | | | normal | | | P3364 | Stereoisomer of | L-iditol | Q27102896 | | | | | normal | | | P3364 | Stereoisomer of | L-sorbitol | Q27103899 | | | | | normal | | | P3364 | Stereoisomer of | D-iditol | Q5989072 | | | | | normal | | | P1014 | Art & Architecture Thesaurus ID | 300380178 | | | | | | normal | https://vocab.getty.edu/page/aat/300380178 | | P267 | ATC code | B05BC01 | | | | | | normal | https://www.whocc.no/atc_ddd_index/?code=B05BC01 | | P508 | BNCF Thesaurus ID | 34785 | | | | | | normal | https://thes.bncf.firenze.sbn.it/termine.php?id=34785 | | P11931 | CAMEO Chemicals ID | 20585 | | | | | | normal | https://cameochemicals.noaa.gov/chemical/20585 | | P11160 | Cannabis Database ID | 006140 | | | | | | normal | https://cannabisdatabase.ca/compounds/CDB006140 | | P231 | CAS Registry Number | 69-65-8 | | | | | | normal | https://commonchemistry.cas.org/detail?cas_rn=69-65-8 | | P683 | ChEBI ID | 16899 | | | | | | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:16899 | | P592 | ChEMBL ID | CHEMBL689 | | | | | | normal | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL689/ | | P661 | ChemSpider ID | 6015 | | | | | | normal | https://www.chemspider.com/Chemical-Structure.6015.html | | P3073 | CosIng number | 35167 | | | | | | normal | https://ec.europa.eu/growth/tools-databases/cosing/details/35167 | | P715 | DrugBank ID | DB00742 | | | | | | normal | https://go.drugbank.com/drugs/DB00742 | | P11198 | DrugCentral ID | 935 | | | | | | normal | https://drugcentral.org/drugcard/935 | | P8494 | DSSTOX compound identifier | DTXCID603235 | | | | | | normal | https://comptox.epa.gov/dashboard/DTXCID603235 | | P3117 | DSSTox substance ID | DTXSID1023235 | | | | | | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID1023235 | | P628 | E number | E421 | | | | | | normal | https://wikidata-externalid-url.toolforge.org/?p=628&url_prefix=http:%2F%2Fwww.fao.org%2Fgsfaonline%2Fadditives%2Fresults.html%3FsearchBy=ins%26ins=&id=E421 | | P232 | EC number | 200-711-8 | | | | | | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/200-711-8 | | P2566 | ECHA Substance Infocard ID | 100.000.647 | | | | | | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.000.647 | | P9635 | Electronic Essential Medicines List medicine ID | 177 | | | | | | normal | https://list.essentialmeds.org/medicines/177 | | P1417 | Encyclopædia Britannica Online ID | science/mannitol | | | | | | normal | https://www.britannica.com/science/mannitol | | P4637 | FoodEx2 code | A033B | | | | | | normal | https://data.food.gov.uk/codes/foodtype/id/A033B | | P646 | Freebase ID | /m/03zf_l | | | | | | normal | https://www.google.com/search?kgmid=/m/03zf_l | | P1578 | Gmelin number | 83161 | | | | | | normal | | | P3720 | GPnotebook ID | 1724907529 | | | | | | normal | https://www.gpnotebook.co.uk/simplepage.cfm?ID=1724907529 | | P12385 | Gran Enciclopèdia Catalana ID | mannitol | | | | | | normal | https://www.enciclopedia.cat/gran-enciclopedia-catalana/mannitol | | P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0121599 | | | | | | normal | https://www.enciclopedia.cat/ec-gec-0121599.xml | | P4342 | Great Norwegian Encyclopedia ID | mannitol | | | | | | normal | https://wikidata-externalid-url.toolforge.org/?p=4342&url_prefix=https://snl.no/&id=mannitol | | P2062 | HSDB ID | 714 | | | | | | normal | https://pubchem.ncbi.nlm.nih.gov/source/hsdb/714 | | P2057 | Human Metabolome Database ID | HMDB0000765 | | | | | | normal | https://www.hmdb.ca/metabolites/HMDB0000765 | | P4168 | IEDB Epitope ID | 114705 | | | | | | normal | http://www.iedb.org/epitope/114705 | | P234 | InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1 | | | | | | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H%2C1-2H2/t3-%2C4-%2C5-%2C6-/m1/s1 | | P235 | InChIKey | FBPFZTCFMRRESA-KVTDHHQDSA-N | | | | | | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22FBPFZTCFMRRESA-KVTDHHQDSA-N%22%5BInChIKey%5D | | P8189 | J9U entity ID | 987007533062405171 | | | | | | normal | https://www.nli.org.il/en/authorities/987007533062405171 | | P665 | KEGG ID | D00062 | | | | | | normal | https://www.kegg.jp/entry/D00062 | | P2064 | KNApSAcK ID | C00001165 | | | | | | normal | https://www.knapsackfamily.com/knapsack_core/information.php?sname=C_ID&word=C00001165 | | P244 | Library of Congress Authorities ID | sh2008008250 | | | | | | normal | https://id.loc.gov/authorities/sh2008008250 | | P6689 | MassBank accession ID | JP010512 | | | | | | normal | https://massbank.eu/MassBank/RecordDisplay?id=JP010512 | | P6694 | MeSH concept ID | M0012995 | | | | | | normal | https://id.nlm.nih.gov/mesh/M0012995 | | P486 | MeSH descriptor ID | D008353 | | | | | | normal | https://meshb.nlm.nih.gov/record/ui?ui=D008353 | | P672 | MeSH tree code | D02.033.800.609 | | | | | | normal | https://id.nlm.nih.gov/mesh/D02.033.800.609 | | P6366 | Microsoft Academic ID (discontinued) | 2778445172 | | | | | | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2778445172 | | P2115 | NDF-RT ID | N0000146108 | | | | | | normal | https://bioportal.bioontology.org/ontologies/NDFRT?p=classes&conceptid=N0000146108 | | P9405 | NMRShiftDB structure ID | 60006045 | | | | | | normal | https://nmrshiftdb.nmr.uni-koeln.de/molecule/60006045 | | P2840 | NSC number | 407017 | | | | | | normal | https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=407017&Submit=Submit | | P1820 | Open Food Facts food additive ID | e421-mannitol | | | | | | normal | https://world.openfoodfacts.org/additive/e421-mannitol | | P5930 | Open Food Facts ingredient ID | mannitol | | | | | | normal | https://world.openfoodfacts.org/facets/ingredients/mannitol | | P10283 | OpenAlex ID | C2909360922 | | | | | | normal | https://openalex.org/C2909360922 | | P4235 | PatientsLikeMe treatment ID | mannitol | | | | | | normal | https://www.patientslikeme.com/treatments/show/mannitol | | P3636 | PDB ligand ID | MTL | | | | | | normal | https://www.rcsb.org/ligand/MTL | | P638 | PDB structure ID | 3N65 | | | | | | normal | https://www.rcsb.org/structure/3N65 | | P11199 | Probes And Drugs ID | PD009837 | | | | | | normal | https://www.probes-drugs.org/compound/PD009837 | | P662 | PubChem CID | 6251 | | | | | | normal | https://pubchem.ncbi.nlm.nih.gov/compound/6251 | | P3417 | Quora topic ID | Mannitol | | | | | | normal | https://www.quora.com/topic/Mannitol | | P1579 | Reaxys registry number | 1721898 | | | | | | normal | | | P3345 | RxNorm CUI | 6628 | | | | | | normal | https://mor.nlm.nih.gov/RxNav/search?searchBy=RXCUI&searchTerm=6628 | | P4964 | SPLASH | splash10-001i-9200000000-0dad802ab0000303cb33 | | | | | | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-001i-9200000000-0dad802ab0000303cb33') | | P2877 | SureChEMBL ID | 919 | | | | | | normal | https://www.surechembl.org/chemical/919 | | P2892 | UMLS CUI | C0024730 | | | | | | normal | https://evsexplore.semantics.cancer.gov/evsexplore/concept/ncim/C0024730 | | P11089 | UniChem compound ID | 478207 | | | | | | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=478207 | | P652 | UNII | 3OWL53L36A | | | | | | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/3OWL53L36A | | P11143 | WikiProjectMed ID | Mannitol | | | | | | normal | https://mdwiki.org/wiki/Mannitol | | P8814 | WordNet 3.1 Synset ID | 03723595-n | | | | | | normal | https://en-word.net/view/synset/03723595-n | | P13591 | Yale LUX ID | concept/5fa9a5e1-9065-4ab7-9eec-1df9036e1161 | | | | | | normal | https://lux.collections.yale.edu/view/concept/5fa9a5e1-9065-4ab7-9eec-1df9036e1161 | | P2347 | YSO ID | 21080 | | | | | | normal | https://www.yso.fi/onto/yso/p21080 | | P679 | ZVG number | 491206 | | | | | | normal | https://wikidata-externalid-url.toolforge.org/?p=679&url_prefix=https%3A%2F%2Fgestis.dguv.de%2Fdata%3Flang%3Den%26name%3D&id=491206 | Source: https://aidb.si/e/d-mannitol-Q407646 — Wikidata (CC0) via AIDB