# cryptoxanthin (Q392062)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P274 | Formula | C₄₀H₅₆O |  |  |  |  |  | normal | Q278487 |
| P233 | Canonical SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CC(CC2(C)C)O)C)C)C |  |  |  |  |  | normal | Q278487 |
| P2017 | Isomeric SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C2=C(C[C@H](CC2(C)C)O)C)/C)/C |  |  |  |  |  | normal | Q278487 |
| P2067 | Mass | 552.433 Da |  | 552.433 | Da |  |  | normal | Q278487 |
| P2868 | Subject has role | Q423960 | Q423960 |  |  |  |  | normal | Medical Subject Headings |
| P2868 | Subject has role | Q3333419 | Q3333419 |  |  |  |  | normal | https://plantreactome.gramene.org/PathwayBrowser/#/R-OSA-2744345&DTAB=MT |
| P703 | Found in taxon | Capsicum annuum | Q1380 |  |  |  |  | normal | Q104247479 \| Q104387558 \| Q104984980 \| Q104387570 \| Q104387943 \| Q104387571 \| Q43582349 \| Q43765942 \| Q104387559 \| Q74337440 \| Q104387560 \| Q60229135 \| Q33433919 |
| P703 | Found in taxon | Diospyros kaki | Q158482 |  |  |  |  | normal | Q104250926 \| Q104915435 \| Q104915436 \| Q104915453 |
| P703 | Found in taxon | Rosa canina | Q146066 |  |  |  |  | normal | Q74555084 \| Q104387565 |
| P703 | Found in taxon | Tethya aurantia | Q104250932 |  |  |  |  | normal | Q104250930 |
| P703 | Found in taxon | Protula tubularia | Q531987 |  |  |  |  | normal | Q104250930 |
| P703 | Found in taxon | Aplysia depilans | Q164336 |  |  |  |  | normal | Q104250930 |
| P703 | Found in taxon | Aplysia fasciata | Q3735973 |  |  |  |  | normal | Q104250930 |
| P703 | Found in taxon | Coscinasterias tenuispina | Q2719831 |  |  |  |  | normal | Q104250930 |
| P703 | Found in taxon | Holothuria tubulosa | Q1984543 |  |  |  |  | normal | Q104250930 |
| P703 | Found in taxon | Parastichopus regalis | Q28319165 |  |  |  |  | normal | Q104250930 |
| P703 | Found in taxon | Lycopodium annotinum | Q1138172 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Lycopodium clavatum | Q466426 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Diphasiastrum tristachyum | Q245842 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Equisetum arvense | Q107592 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Equisetum hyemale | Q263881 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Equisetum fluviatile | Q948839 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Equisetum telmateia | Q936546 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Equisetum palustre | Q21122 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Equisetum pratense | Q1123127 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Equisetum sylvaticum | Q1355107 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Adiantum capillus-veneris | Q4678994 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Adiantum formosum | Q950658 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Adiantum pedatum | Q1199865 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Coniogramme japonica | Q10896043 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Cyrtomium falcatum | Q2415732 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Dryopteris carthusiana | Q523210 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Dryopteris dilatata | Q905897 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Dryopteris filix-mas | Q322994 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Cyclosorus parasiticus | Q10905565 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Polystichum aculeatum | Q28957 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Asplenium australasicum | Q4235309 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Asplenium nidus | Q1736890 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Asplenium trichomanes | Q902211 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Athyrium filix-femina | Q1345500 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Cystopteris bulbifera | Q5201282 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Cystopteris sudetica | Q202067 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Diplazium sibiricum | Q4356391 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Azolla microphylla | Q17046927 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Blechnum spicant | Q925696 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Nephrolepis cordifolia | Q1040814 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Nephrolepis exaltata | Q136883 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Onoclea sensibilis | Q718312 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Platycerium alcicorne | Q4364577 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Phlebodium aureum | Q1231082 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Polypodium vulgare | Q743883 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Pellaea atropurpurea | Q2388502 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Pellaea rotundifolia | Q7161522 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Pteris cretica | Q2050113 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Pteris longifolia | Q7256691 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Pteris tremula | Q7256693 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Oreopteris limbosperma | Q2678657 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Pteridium aquilinum | Q213548 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Metasequoia glyptostroboides | Q156800 |  |  |  |  | normal | Q104250946 |
| P703 | Found in taxon | Cladonia rangiferina | Q248744 |  |  |  |  | normal | Q100145664 \| Q104915431 |
| P703 | Found in taxon | Cladonia portentosa | Q1278746 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia mitis | Q3678915 |  |  |  |  | normal | Q100145664 \| Q104915431 |
| P703 | Found in taxon | Cladonia cariosa | Q3678841 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia cenotea | Q3678845 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia coccifera | Q113273 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia cornuta | Q3678857 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia deformis | Q3678868 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia phyllophora | Q3678931 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia digitata | Q2974936 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia fimbriata | Q456384 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia glauca | Q3678887 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia gracilis | Q3678888 |  |  |  |  | normal | Q100145664 \| Q104915431 |
| P703 | Found in taxon | Cladonia macilenta | Q3678901 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia ochrochlora | Q3678922 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia ramulosa | Q3678939 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia pleurota | Q3678932 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia scabriuscula | Q3678942 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Cladonia turgida | Q3678952 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Citrus unshiu | Q875262 |  |  |  |  | normal | Q74234541 \| Q53416058 |
| P703 | Found in taxon | Dryopteris parasitica | Q104668367 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Thelypteris palustris var. pubescens | Q11126620 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Asplenium scolopendrium var. scolopendrium | Q67198806 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Cladonia ciliata var. tenuis | Q21379660 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Pantoea agglomerans | Q6336019 |  |  |  |  | normal | Q42687366 |
| P703 | Found in taxon | Pantoea ananatis | Q26270527 |  |  |  |  | normal | Q28332226 |
| P703 | Found in taxon | Medicago arabica | Q159140 |  |  |  |  | normal | Q104984976 |
| P703 | Found in taxon | Medicago cancellata | Q15433613 |  |  |  |  | normal | Q104984977 |
| P703 | Found in taxon | Medicago carstiensis | Q6806239 |  |  |  |  | normal | Q104984977 |
| P703 | Found in taxon | Medicago cretacea | Q15433893 |  |  |  |  | normal | Q104984976 |
| P703 | Found in taxon | Medicago hybrida | Q15433603 |  |  |  |  | normal | Q104984976 |
| P703 | Found in taxon | Medicago marina | Q770636 |  |  |  |  | normal | Q104984977 |
| P703 | Found in taxon | Medicago prostrata | Q12230842 |  |  |  |  | normal | Q104984977 |
| P703 | Found in taxon | Medicago ruthenica | Q15434810 |  |  |  |  | normal | Q104984976 |
| P703 | Found in taxon | Medicago suffruticosa | Q15434611 |  |  |  |  | normal | Q104984976 |
| P703 | Found in taxon | Passiflora edulis | Q156790 |  |  |  |  | normal | Q104918315 |
| P703 | Found in taxon | Psidium guajava | Q166843 |  |  |  |  | normal | Q33880535 |
| P703 | Found in taxon | Vicia articulata | Q12200679 |  |  |  |  | normal | Q104984978 |
| P703 | Found in taxon | Vicia ervilia | Q163064 |  |  |  |  | normal | Q104984978 |
| P703 | Found in taxon | Aspleniaceae | Q1137402 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Aronia melanocarpa | Q162774 |  |  |  |  | normal | Q104387565 \| Q115965661 |
| P703 | Found in taxon | Asparagus officinalis | Q28367 |  |  |  |  | normal | Q104387560 \| Q54561591 |
| P703 | Found in taxon | Averrhoa carambola | Q159447 |  |  |  |  | normal | Q104387961 |
| P703 | Found in taxon | Beta vulgaris | Q165191 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Brassica oleracea | Q146212 |  |  |  |  | normal | Q104387558 \| Q104387560 \| Q115784644 \| Q115784645 |
| P703 | Found in taxon | Camellia sasanqua | Q2590046 |  |  |  |  | normal | Q104915430 |
| P703 | Found in taxon | Celastrus orbiculatus | Q259033 |  |  |  |  | normal | Q45997738 |
| P703 | Found in taxon | Cetraria andrejevii | Q59545209 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Cetraria nigricans | Q10684399 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Nephromopsis nivalis | Q52708201 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Cladonia foliacea | Q887020 |  |  |  |  | normal | Q104912618 |
| P703 | Found in taxon | Cucumis melo | Q81602 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Cucurbita | Q5339301 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Cucurbita pepo | Q7229863 |  |  |  |  | normal | Q104387558 |
| P703 | Found in taxon | Daucus carota | Q30056 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Erythrotrichia carnea | Q34583845 |  |  |  |  | normal | Q104984985 |
| P703 | Found in taxon | Fragaria | Q745 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Abelmoschus esculentus | Q80531 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Hibiscus syriacus | Q157756 |  |  |  |  | normal | Q104915437 |
| P703 | Found in taxon | Sweet potato | Q37937 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Lactuca sativa | Q83193 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Laminaria digitata | Q1093337 |  |  |  |  | normal | Q104387568 |
| P703 | Found in taxon | Saccharina latissima | Q228105 |  |  |  |  | normal | Q104387568 |
| P703 | Found in taxon | Lobaria pulmonaria | Q1281000 |  |  |  |  | normal | Q104912618 |
| P703 | Found in taxon | Mangifera indica | Q3919027 |  |  |  |  | normal | Q73163511 |
| P703 | Found in taxon | Momordica charantia | Q428750 |  |  |  |  | normal | Q104915440 \| Q34167699 |
| P703 | Found in taxon | Nephroma arcticum | Q10602877 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Nephroma laevigatum | Q10718170 |  |  |  |  | normal | Q104912618 |
| P703 | Found in taxon | Nephroma parile | Q10438613 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Orthosiphon grandiflorus | Q104850548 |  |  |  |  | normal | Q104915443 |
| P703 | Found in taxon | Planktothrix agardhii | Q1020759 |  |  |  |  | normal | Q104984989 \| Q104103262 |
| P703 | Found in taxon | Oscillatoria limosa | Q67368354 |  |  |  |  | normal | Q104984989 |
| P703 | Found in taxon | Oscillatoria rubescens | Q104984990 |  |  |  |  | normal | Q104984989 |
| P703 | Found in taxon | Peltigera rufescens | Q10549593 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | channelled wrack | Q1669623 |  |  |  |  | normal | Q104387568 |
| P703 | Found in taxon | Phaseolus vulgaris | Q42339 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Pisum sativum | Q25237 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Prunus armeniaca | Q37453 |  |  |  |  | normal | Q104387560 \| Q34391158 \| Q46631468 |
| P703 | Found in taxon | Prunus persica | Q13189 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Rhinogobius brunneus | Q2663239 |  |  |  |  | normal | Q74104189 |
| P703 | Found in taxon | Rosa rugosa | Q634975 |  |  |  |  | normal | Q104387565 |
| P703 | Found in taxon | Rubus idaeus | Q12252383 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Sandersonia aurantiaca | Q657297 |  |  |  |  | normal | Q104984991 |
| P703 | Found in taxon | potato | Q10998 |  |  |  |  | normal | Q104387558 \| Q44214348 |
| P703 | Found in taxon | Sorbus aucuparia | Q146198 |  |  |  |  | normal | Q104915445 |
| P703 | Found in taxon | Spinacia oleracea | Q81464 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Stereocaulon alpinum | Q10496059 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Stereocaulon arenarium | Q21321385 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Stereocaulon paschale | Q10647928 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Stereocaulon vesuvianum | Q3973243 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Stereocaulon vulcani | Q3498741 |  |  |  |  | normal | Q104912618 |
| P703 | Found in taxon | Sticta canariensis | Q21320776 |  |  |  |  | normal | Q104912618 |
| P703 | Found in taxon | Q759876 | Q759876 |  |  |  |  | normal | Q73188162 |
| P703 | Found in taxon | Q271179 | Q271179 |  |  |  |  | normal | Q104984993 |
| P703 | Found in taxon | Q10547034 | Q10547034 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Q10667752 | Q10667752 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Q7881331 | Q7881331 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Q468695 | Q468695 |  |  |  |  | normal | Q104387560 |
| P703 | Found in taxon | Q4672006 | Q4672006 |  |  |  |  | normal | Q104984994 |
| P703 | Found in taxon | Q207848 | Q207848 |  |  |  |  | normal | Q69573587 |
| P703 | Found in taxon | Q161180 | Q161180 |  |  |  |  | normal | Q104984995 |
| P703 | Found in taxon | Q104384475 | Q104384475 |  |  |  |  | normal | Q104984994 |
| P703 | Found in taxon | Q104984996 | Q104984996 |  |  |  |  | normal | Q104103262 \| Q104984989 |
| P703 | Found in taxon | Q146281 | Q146281 |  |  |  |  | normal | Q104915451 |
| P703 | Found in taxon | Q22112777 | Q22112777 |  |  |  |  | normal | Q104908842 |
| P703 | Found in taxon | Q159499 | Q159499 |  |  |  |  | normal | Q104908842 |
| P703 | Found in taxon | Q3678877 | Q3678877 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Q611140 | Q611140 |  |  |  |  | normal | Q33302176 |
| P703 | Found in taxon | Q21260910 | Q21260910 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q165315 | Q165315 |  |  |  |  | normal | Q105104084 |
| P703 | Found in taxon | Q7224565 | Q7224565 |  |  |  |  | normal | Q64256930 |
| P703 | Found in taxon | Q312736 | Q312736 |  |  |  |  | normal | Q80147286 |
| P703 | Found in taxon | Q1016076 | Q1016076 |  |  |  |  | normal | Q104984989 |
| P703 | Found in taxon | Q2673246 | Q2673246 |  |  |  |  | normal | Q104915443 |
| P703 | Found in taxon | Q50409961 | Q50409961 |  |  |  |  | normal | Q104984994 |
| P703 | Found in taxon | Q67362411 | Q67362411 |  |  |  |  | normal | Q104984989 \| Q104103262 |
| P703 | Found in taxon | Q41350 | Q41350 |  |  |  |  | normal | Q104387560 \| Q104387555 |
| P703 | Found in taxon | Q2523014 | Q2523014 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q104249344 | Q104249344 |  |  |  |  | normal | Q104387568 |
| P703 | Found in taxon | Q158695 | Q158695 |  |  |  |  | normal | Q92005646 |
| P703 | Found in taxon | Q23501 | Q23501 |  |  |  |  | normal | Q33465793 |
| P703 | Found in taxon | Q125337 | Q125337 |  |  |  |  | normal | Q74234541 \| Q53416058 |
| P703 | Found in taxon | Q20686225 | Q20686225 |  |  |  |  | normal | Q74234541 \| Q53416058 |
| P703 | Found in taxon | Q3007914 | Q3007914 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q17187973 | Q17187973 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q2705087 | Q2705087 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q937406 | Q937406 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q36441870 | Q36441870 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Q2068479 | Q2068479 |  |  |  |  | normal | Q104250930 |
| P703 | Found in taxon | Q2498293 | Q2498293 |  |  |  |  | normal | Q104915430 |
| P703 | Found in taxon | Q15601875 | Q15601875 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q1301661 | Q1301661 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q2079766 | Q2079766 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Q10496793 | Q10496793 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Q10710191 | Q10710191 |  |  |  |  | normal | Q104915431 |
| P703 | Found in taxon | Q3678881 | Q3678881 |  |  |  |  | normal | Q104912618 |
| P703 | Found in taxon | Q14565729 | Q14565729 |  |  |  |  | normal | Q70386304 |
| P703 | Found in taxon | Q84861563 | Q84861563 |  |  |  |  | normal | Q100145664 |
| P703 | Found in taxon | Q50834570 | Q50834570 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q5309785 | Q5309785 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q2036293 | Q2036293 |  |  |  |  | normal | Q104250937 |
| P703 | Found in taxon | Q30046 | Q30046 |  |  |  |  | normal | Q104387552 |
| P361 | Part of | beta-cryptoxanthin hydroxylase activity | Q22320006 |  |  |  |  | normal | http://geneontology.org/external2go/rhea2go |
| P361 | Part of | beta-carotene 3-hydroxylase activity | Q22320004 |  |  |  |  | normal | http://geneontology.org/external2go/rhea2go |
| P279 | Subclass of | carotenoid | Q191907 |  |  |  |  | normal |  |
| P279 | Subclass of | provitamin A | Q11336114 |  |  |  |  | normal |  |
| P3364 | Stereoisomer of | Q27268351 | Q27268351 |  |  |  |  | normal |  |
| P3364 | Stereoisomer of | Q104391201 | Q104391201 |  |  |  |  | normal |  |
| P11160 | Cannabis Database ID | 005215 |  |  |  |  |  | normal | https://cannabisdatabase.ca/compounds/CDB005215 |
| P231 | CAS Registry Number | 472-70-8 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=472-70-8 |
| P683 | ChEBI ID | 10362 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:10362 |
| P661 | ChemSpider ID | 4444647 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.4444647.html |
| P715 | DrugBank ID | DB15914 |  |  |  |  |  | normal | https://go.drugbank.com/drugs/DB15914 |
| P8494 | DSSTOX compound identifier | DTXCID301341331 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID301341331 |
| P3117 | DSSTox substance ID | DTXSID30912309 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID30912309 |
| P628 | E number | E161c |  |  |  |  |  | normal | https://wikidata-externalid-url.toolforge.org/?p=628&url_prefix=http:%2F%2Fwww.fao.org%2Fgsfaonline%2Fadditives%2Fresults.html%3FsearchBy=ins%26ins=&id=E161c |
| P646 | Freebase ID | /m/027g6p7 |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/027g6p7 |
| P2057 | Human Metabolome Database ID | HMDB0033844 |  |  |  |  |  | normal | https://www.hmdb.ca/metabolites/HMDB0033844 |
| P234 | InChI | InChI=1S/C40H56O/c1-30(18-13-20-32(3)23-25-37-34(5)22-15-27-39(37,7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-38-35(6)28-36(41)29-40(38,9)10/h11-14,16-21,23-26,36,41H,15,22,27-29H2,1-10H3/b12-11+,18-13+,19-14+,25-23+,26-24+,30-16+,31-17+,32-20+,33-21+/t36-/m1/s1 |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C40H56O/c1-30(18-13-20-32(3)23-25-37-34(5)22-15-27-39(37%2C7)8)16-11-12-17-31(2)19-14-21-33(4)24-26-38-35(6)28-36(41)29-40(38%2C9)10/h11-14%2C16-21%2C23-26%2C36%2C41H%2C15%2C22%2C27-29H2%2C1-10H3/b12-11%2B%2C18-13%2B%2C19-14%2B%2C25-23%2B%2C26-24%2B%2C30-16%2B%2C31-17%2B%2C32-20%2B%2C33-21%2B/t36-/m1/s1 |
| P235 | InChIKey | DMASLKHVQRHNES-FKKUPVFPSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22DMASLKHVQRHNES-FKKUPVFPSA-N%22%5BInChIKey%5D |
| P665 | KEGG ID | C08591 |  |  |  |  |  | normal | https://www.kegg.jp/entry/C08591 |
| P2064 | KNApSAcK ID | C00000920 |  |  |  |  |  | normal | https://www.knapsackfamily.com/knapsack_core/information.php?sname=C_ID&word=C00000920 |
| P2063 | LIPID MAPS ID | LMPR01070269 |  |  |  |  |  | normal | https://www.lipidmaps.org/data/structure/LMSDSearch.php?Mode=ProcessClassSearch&LMID=LMPR01070269 |
| P6689 | MassBank accession ID | MSBNK-Kyoto_Univ-CA000038 |  |  |  |  |  | normal | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Kyoto_Univ-CA000038 |
| P486 | MeSH descriptor ID | D000072743 |  |  |  |  |  | normal | https://meshb.nlm.nih.gov/record/ui?ui=D000072743 |
| P672 | MeSH tree code | D02.455.326.271.665.202.868.374.500 |  |  |  |  |  | normal | https://id.nlm.nih.gov/mesh/D02.455.326.271.665.202.868.374.500 |
| P6366 | Microsoft Academic ID (discontinued) | 2778268477 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2778268477 |
| P5930 | Open Food Facts ingredient ID | en:e161c |  |  |  |  |  | normal | https://world.openfoodfacts.org/facets/ingredients/en%3Ae161c |
| P3636 | PDB ligand ID | RRX |  |  |  |  |  | normal | https://www.rcsb.org/ligand/RRX |
| P638 | PDB structure ID | 3WU2 |  |  |  |  |  | normal | https://www.rcsb.org/structure/3WU2 |
| P11199 | Probes And Drugs ID | PD143838 |  |  |  |  |  | normal | https://www.probes-drugs.org/compound/PD143838 |
| P662 | PubChem CID | 5281235 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/5281235 |
| P1579 | Reaxys registry number | 2230123 |  |  |  |  |  | normal |  |
| P4964 | SPLASH | splash10-03e2-0000940000-3f294d1b8006a14a01ff |  |  |  |  |  | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-03e2-0000940000-3f294d1b8006a14a01ff') |
| P2877 | SureChEMBL ID | 24469 |  |  |  |  |  | normal | https://www.surechembl.org/chemical/24469 |
| P8691 | SwissLipids ID | SLM:000501171 |  |  |  |  |  | normal | https://www.swisslipids.org/#/entity/SLM%3A000501171/ |
| P2892 | UMLS CUI | C0896117 |  |  |  |  |  | normal | https://evsexplore.semantics.cancer.gov/evsexplore/concept/ncim/C0896117 |
| P11089 | UniChem compound ID | 1069578 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=1069578 |
| P652 | UNII | 6ZIB13GI33 |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/6ZIB13GI33 |

Source: https://aidb.si/e/cryptoxanthin-Q392062 — Wikidata (CC0) via AIDb