# repaglinide (Q2195995)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P274 | Formula | C₂₇H₃₆N₂O₄ |  |  |  |  |  | normal | PubChem |
| P2275 | World Health Organisation  international non-proprietary name | repaglinide |  |  |  |  |  | normal | ChEMBL |
| P2175 | Medical condition treated | maturity-onset diabetes of the young type 2 | Q32147145 |  |  |  |  | normal | NDF-RT |
| P2017 | Isomeric SMILES | CCOC1=C(C=CC(=C1)CC(=O)N[C@@H](CC(C)C)C2=CC=CC=C2N3CCCCC3)C(=O)O |  |  |  |  |  | normal | PubChem |
| P233 | Canonical SMILES | CCOC1=C(C=CC(=C1)CC(=O)NC(CC(C)C)C2=CC=CC=C2N3CCCCC3)C(=O)O |  |  |  |  |  | normal | PubChem |
| P2067 | Mass | 452.2675 Da |  | 452.267508 | Da |  |  | normal | PubChem |
| P3489 | Pregnancy category | Australian pregnancy category C | Q3679261 |  |  |  |  | normal |  |
| P3489 | Pregnancy category | US pregnancy category C | Q28123617 |  |  |  |  | normal |  |
| P3780 | Active ingredient in | Enyglid | Q29005808 |  |  |  |  | normal | http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/001065/human_med_000766.jsp |
| P3780 | Active ingredient in | Novonorm | Q29006231 |  |  |  |  | normal | http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/000187/human_med_000934.jsp |
| P3780 | Active ingredient in | Prandin | Q29006356 |  |  |  |  | normal | RxNorm |
| P3780 | Active ingredient in | Repaglinide Accord | Q29006420 |  |  |  |  | normal | http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/002318/human_med_001533.jsp |
| P3780 | Active ingredient in | Repaglinide Krka | Q29006422 |  |  |  |  | normal | http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/001066/human_med_001027.jsp |
| P3780 | Active ingredient in | Repaglinide Teva | Q29006423 |  |  |  |  | normal | http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/human/medicines/001067/human_med_001028.jsp |
| P4250 | Defined daily dose | 4 milligram |  | 4 | milligram |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=A10BX02 |
| P2868 | Subject has role | anti-diabetic medication | Q575062 |  |  |  |  | normal | Medical Subject Headings |
| P129 | Physically interacts with | ATP binding cassette subfamily C member 8 | Q21113671 |  |  |  |  | normal | IUPHAR/BPS Guide to PHARMACOLOGY |
| P129 | Physically interacts with | Potassium inwardly rectifying channel subfamily J member 11 | Q6414726 |  |  |  |  | normal | https://platform.opentargets.org/drug/CHEMBL1272 |
| P703 | Found in taxon | Salvia regla | Q12845466 |  |  |  |  | normal | Abietane and clerodane diterpenes from Salvia regla |
| P279 | Subclass of | piperidine alkaloids | Q17325708 |  |  |  |  | normal |  |
| P279 | Subclass of | heterocyclic compound | Q193430 |  |  |  |  | normal |  |
| P366 | Has use | medication | Q12140 |  |  |  |  | normal |  |
| P3364 | Stereoisomer of | (-)-repaglinide | Q27269656 |  |  |  |  | normal |  |
| P267 | ATC code | A10BX02 |  |  |  |  |  | normal | https://www.whocc.no/atc_ddd_index/?code=A10BX02 |
| P8072 | CAB ID | 188350 |  |  |  |  |  | normal | https://www.cabi.org/cabithesaurus/mtwdk.exe?k=default&l=60&w=188350&s=5&t=2 |
| P231 | CAS Registry Number | 135062-02-1 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=135062-02-1 |
| P683 | ChEBI ID | 8805 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:8805 |
| P592 | ChEMBL ID | CHEMBL1272 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL1272/ |
| P661 | ChemSpider ID | 59377 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.59377.html |
| P715 | DrugBank ID | DB00912 |  |  |  |  |  | normal | https://go.drugbank.com/drugs/DB00912 |
| P11198 | DrugCentral ID | 2366 |  |  |  |  |  | normal | https://drugcentral.org/drugcard/2366 |
| P8494 | DSSTOX compound identifier | DTXCID603552 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID603552 |
| P3117 | DSSTox substance ID | DTXSID3023552 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID3023552 |
| P232 | EC number | 629-921-1 |  |  |  |  |  | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/629-921-1 |
| P2566 | ECHA Substance Infocard ID | 100.158.190 |  |  |  |  |  | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.158.190 |
| P1417 | Encyclopædia Britannica Online ID | topic/repaglinide |  |  |  |  |  | normal | https://www.britannica.com/topic/repaglinide |
| P646 | Freebase ID | /m/09_f8g |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/09_f8g |
| P595 | Guide to Pharmacology Ligand ID | 6841 |  |  |  |  |  | normal | https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=6841 |
| P2057 | Human Metabolome Database ID | HMDB0015048 |  |  |  |  |  | normal | https://www.hmdb.ca/metabolites/HMDB0015048 |
| P234 | InChI | InChI=1S/C27H36N2O4/c1-4-33-25-17-20(12-13-22(25)27(31)32)18-26(30)28-23(16-19(2)3)21-10-6-7-11-24(21)29-14-8-5-9-15-29/h6-7,10-13,17,19,23H,4-5,8-9,14-16,18H2,1-3H3,(H,28,30)(H,31,32)/t23-/m0/s1 |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C27H36N2O4/c1-4-33-25-17-20(12-13-22(25)27(31)32)18-26(30)28-23(16-19(2)3)21-10-6-7-11-24(21)29-14-8-5-9-15-29/h6-7%2C10-13%2C17%2C19%2C23H%2C4-5%2C8-9%2C14-16%2C18H2%2C1-3H3%2C(H%2C28%2C30)(H%2C31%2C32)/t23-/m0/s1 |
| P235 | InChIKey | FAEKWTJYAYMJKF-QHCPKHFHSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22FAEKWTJYAYMJKF-QHCPKHFHSA-N%22%5BInChIKey%5D |
| P665 | KEGG ID | C07670 |  |  |  |  |  | normal | https://www.kegg.jp/entry/C07670 |
| P6689 | MassBank accession ID | MSBNK-Athens_Univ-AU218901 |  |  |  |  |  | normal | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Athens_Univ-AU218901 |
| P10245 | MedlinePlus drug identifier | a600010 |  |  |  |  |  | normal | https://medlineplus.gov/druginfo/meds/a600010.html |
| P486 | MeSH descriptor ID | C072379 |  |  |  |  |  | normal | https://meshb.nlm.nih.gov/record/ui?ui=C072379 |
| P6366 | Microsoft Academic ID (discontinued) | 2781281211 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2781281211 |
| P2115 | NDF-RT ID | N0000148573 |  |  |  |  |  | normal | https://bioportal.bioontology.org/ontologies/NDFRT?p=classes&conceptid=N0000148573 |
| P2840 | NSC number | 759893 |  |  |  |  |  | normal | https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=759893&Submit=Submit |
| P10283 | OpenAlex ID | C2781281211 |  |  |  |  |  | normal | https://openalex.org/C2781281211 |
| P4235 | PatientsLikeMe treatment ID | repaglinide |  |  |  |  |  | normal | https://www.patientslikeme.com/treatments/show/repaglinide |
| P3636 | PDB ligand ID | BJX |  |  |  |  |  | normal | https://www.rcsb.org/ligand/BJX |
| P11199 | Probes And Drugs ID | PD000219 |  |  |  |  |  | normal | https://www.probes-drugs.org/compound/PD000219 |
| P662 | PubChem CID | 65981 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/65981 |
| P3417 | Quora topic ID | Repaglinide |  |  |  |  |  | normal | https://www.quora.com/topic/Repaglinide |
| P3345 | RxNorm CUI | 73044 |  |  |  |  |  | normal | https://mor.nlm.nih.gov/RxNav/search?searchBy=RXCUI&searchTerm=73044 |
| P4964 | SPLASH | splash10-0udi-0140900000-4fef8b8042e88aa84955 |  |  |  |  |  | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-0udi-0140900000-4fef8b8042e88aa84955') |
| P2877 | SureChEMBL ID | 16137 |  |  |  |  |  | normal | https://www.surechembl.org/chemical/16137 |
| P2892 | UMLS CUI | C0246689 |  |  |  |  |  | normal | https://evsexplore.semantics.cancer.gov/evsexplore/concept/ncim/C0246689 |
| P11089 | UniChem compound ID | 168210 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=168210 |
| P652 | UNII | 668Z8C33LU |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/668Z8C33LU |
| P11143 | WikiProjectMed ID | Repaglinide |  |  |  |  |  | normal | https://mdwiki.org/wiki/Repaglinide |

Source: https://aidb.si/e/repaglinide-Q2195995 — Wikidata (CC0) via AIDB