# decaborane (Q1951971)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P274 | Formula | B₁₀H₁₄ |  |  |  |  |  | normal |  |
| P233 | Canonical SMILES | [H]1[BH]234[BH]156[BH]278[BH]39([H]4)[BH]712[BH]853[BH]645[BH]311[BH]922[BH]14([H]5)[H]2 |  |  |  |  |  | normal |  |
| P233 | Canonical SMILES | [BH3]1[BH]23[BH]45[BH]26[BH]37[BH]18[BH]79[BH]64[BH]89[BH3]5 |  |  |  |  |  | normal |  |
| P1931 | NIOSH Pocket Guide ID | 0175 |  |  |  |  |  | normal |  |
| P527 | Members / parts | boron | Q618 |  |  |  |  | normal |  |
| P527 | Members / parts | hydrogen | Q556 |  |  |  |  | normal |  |
| P2054 | Density | 0.94 g/cm³ |  | 0.94 | g/cm³ |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P1542 | Has effect | decaborane exposure | Q21174132 |  |  |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P2129 | Immediately dangerous to life or health | 15 milligram per cubic metre |  | 15 | milligram per cubic metre |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P2101 | Melting point | 211°F |  | 211 | °F |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P2102 | Boiling point | 415°F |  | 415 | °F |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P2119 | Vapor pressure | 0.2 millimetre of mercury |  | 0.2 | millimetre of mercury |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P2128 | Flash point | 176°F |  | 176 | °F |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P2260 | Ionization energy | 9.88 eV |  | 9.88 | eV |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P2404 | Time-weighted average exposure limit | 0.3 milligram per cubic metre |  | 0.3 | milligram per cubic metre |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P2407 | Short-term exposure limit | 0.9 milligram per cubic metre |  | 0.9 | milligram per cubic metre |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P1552 | Has characteristic | flammable solid | Q21073024 |  |  |  |  | normal | http://www.cdc.gov/niosh/npg/npgd0175.html |
| P279 | Subclass of | chemical compound | Q11173 |  |  |  |  | normal |  |
| P2067 | Mass | 110.0931 Da |  | 110.09305400000002 | Da |  |  | normal |  |
| P3335 | Associated hazard | decaborane exposure | Q21174132 |  |  |  |  | normal |  |
| P11931 | CAMEO Chemicals ID | 503 |  |  |  |  |  | normal | https://cameochemicals.noaa.gov/chemical/503 |
| P231 | CAS Registry Number | 17702-41-9 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=17702-41-9 |
| P661 | ChemSpider ID | 21241886 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.21241886.html |
| P8494 | DSSTOX compound identifier | DTXCID301021656 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID301021656 |
| P3117 | DSSTox substance ID | DTXSID80880049 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID80880049 |
| P232 | EC number | 241-711-8 |  |  |  |  |  | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/241-711-8 |
| P2566 | ECHA Substance Infocard ID | 100.037.904 |  |  |  |  |  | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.037.904 |
| P646 | Freebase ID | /m/0450l_ |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/0450l_ |
| P4342 | Great Norwegian Encyclopedia ID | dekaboran |  |  |  |  |  | normal | https://wikidata-externalid-url.toolforge.org/?p=4342&url_prefix=https://snl.no/&id=dekaboran |
| P2062 | HSDB ID | 2515 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2515 |
| P5220 | ICSC ID | 0712 |  |  |  |  |  | normal | https://chemicalsafety.ilo.org/dyn/icsc/showcard.display?p_card_id=0712 |
| P234 | InChI | InChI=1S/B10/c1-3-5-7-9-10-8-6-4-2 |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/B10/c1-3-5-7-9-10-8-6-4-2 |
| P235 | InChIKey | SXQKYQKNQZAWBF-UHFFFAOYSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22SXQKYQKNQZAWBF-UHFFFAOYSA-N%22%5BInChIKey%5D |
| P6366 | Microsoft Academic ID (discontinued) | 2778700440 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2778700440 |
| P2840 | NSC number | 39828 |  |  |  |  |  | normal | https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=39828&Submit=Submit |
| P10283 | OpenAlex ID | C2778700440 |  |  |  |  |  | normal | https://openalex.org/C2778700440 |
| P12594 | OSHA Occupational Chemical Database ID | 297 |  |  |  |  |  | normal | https://www.osha.gov/chemicaldata/297 |
| P662 | PubChem CID | 6328162 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/6328162 |
| P657 | RTECS number | HD1400000 |  |  |  |  |  | normal |  |
| P11089 | UniChem compound ID | 55617250 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=55617250 |
| P652 | UNII | 4O04290A2J |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/4O04290A2J |
| P679 | ZVG number | 570109 |  |  |  |  |  | normal | https://wikidata-externalid-url.toolforge.org/?p=679&url_prefix=https%3A%2F%2Fgestis.dguv.de%2Fdata%3Flang%3Den%26name%3D&id=570109 |

Source: https://aidb.si/e/decaborane-Q1951971 — Wikidata (CC0) via AIDb