# thymine (Q171973)

| Property ID | Property | Value | Value entity | Amount | Unit | Date / from | Until | Rank | Sources |
| --- | --- | --- | --- | ---: | --- | --- | --- | --- | --- |
| P279 | Subclass of | nucleotide base | Q422960 |  |  |  |  | normal |  |
| P279 | Subclass of | pyrimidine | Q47069735 |  |  |  |  | normal |  |
| P233 | Canonical SMILES | CC1=CNC(=O)NC1=O |  |  |  |  |  | normal | PubChem |
| P31 | Instance of | type of chemical entity | Q113145171 |  |  |  |  | normal |  |
| P274 | Formula | C₅H₆N₂O₂ |  |  |  |  |  | normal | PubChem |
| P527 | Members / parts | nitrogen | Q627 |  |  |  |  | normal |  |
| P527 | Members / parts | oxygen | Q629 |  |  |  |  | normal |  |
| P527 | Members / parts | carbon | Q623 |  |  |  |  | normal |  |
| P527 | Members / parts | hydrogen | Q556 |  |  |  |  | normal |  |
| P2067 | Mass | 126.043 Da |  | 126.043 | Da |  |  | normal | PubChem |
| P703 | Found in taxon | Homo sapiens | Q15978631 |  |  |  |  | normal | Recon 2.2: from reconstruction to model of human metabolism \| Physiological and environmental parameters associated with mass spectrometry-based salivary metabolomic profiles \| A community-driven global reconstruction of human metabolism. |
| P703 | Found in taxon | Junceella juncea | Q3319178 |  |  |  |  | normal | Study on the chemical constituents of the South China Sea gorgonian Junceella juncea |
| P703 | Found in taxon | Stylissa massa | Q2045933 |  |  |  |  | normal | Antineoplastic agents. 362. Isolation and X-ray crystal structure of dibromophakellstatin from the Indian ocean sponge Phakellia mauritiana |
| P703 | Found in taxon | Viscum coloratum | Q15356924 |  |  |  |  | normal | The inhibition of superoxide anion generation in human neutrophils by Viscum coloratum |
| P703 | Found in taxon | Echinoclathria gibbosa | Q2605844 |  |  |  |  | normal | New compounds from the Red Sea marine sponge Echinoclathria gibbosa |
| P703 | Found in taxon | Eleutherococcus giraldii | Q11127543 |  |  |  |  | normal | Chemical constituents from Acanthopanax brachypus |
| P703 | Found in taxon | Amphimedon viridis | Q1956924 |  |  |  |  | normal | Isolation and Characterization of 1,3-Dimethylisoguanine from the Bermudian Sponge Amphimedon viridis |
| P703 | Found in taxon | Carteriospongia | Q4116794 |  |  |  |  | normal | Hydrophilic metabolites from the tropical marine sponge Carteriospongia sp. |
| P703 | Found in taxon | Ophiocordyceps sinensis | Q398300 |  |  |  |  | normal | Analysis of the Water Soluble Constituents ofCordyceps SinensisWith Heuristic Evolving Latent Projections \| Anti-inflammatory Principles from Cordyceps sinensis |
| P703 | Found in taxon | Crocus sativus | Q15041677 |  |  |  |  | normal | Constituents of the stigmas of Crocus sativus and their tyrosinase inhibitory activity \| Constituents of the pollen of Crocus sativus L. and their tyrosinase inhibitory activity \| Constituents of the Pollen of Crocus sativus L. and Their Tyrosinase Inhibitory Activity. |
| P703 | Found in taxon | Geodia japonica | Q3065314 |  |  |  |  | normal | Isomalabaricane-Type Nortriterpenoids and Other Constituents of the Marine Sponge Geodia japonica |
| P703 | Found in taxon | Nothapodytes nimmoniana | Q13113387 |  |  |  |  | normal | Constituents and cytotoxic principles of Nothapodytes foetida |
| P703 | Found in taxon | Pancratium maritimum | Q1271785 |  |  |  |  | normal | Alkaloids of the flowers of Pancratium maritimum |
| P703 | Found in taxon | Tectitethya | Q3463346 |  |  |  |  | normal | Isolation of Spongosine and 2'-Deoxyspongosine from a Western Australian Sponge of the Order Hadromerida (Tethyidae) |
| P703 | Found in taxon | Streptomyces piomogenus | Q104859548 |  |  |  |  | normal | Penicisteroid C: New polyoxygenated steroid produced by co-culturing of Streptomyces piomogenus with Aspergillus niger |
| P703 | Found in taxon | Agelas dendromorpha | Q2014834 |  |  |  |  | normal | Agelastatin E, agelastatin F, and benzosceptrin C from the marine sponge Agelas dendromorpha |
| P703 | Found in taxon | Huperzia serrata | Q1044073 |  |  |  |  | normal | Bioactive metabolites from Penicillium sp. P-1, a fungal endophyte in Huperzia serrata |
| P703 | Found in taxon | Vibrio parahaemolyticus | Q134280 |  |  |  |  | normal | New indole alkaloids from the North Sea bacterium Vibrio parahaemolyticus Bio249. |
| P703 | Found in taxon | Wallemia sebi | Q10719179 |  |  |  |  | normal | Aromatic compounds from the halotolerant fungal strain of Wallemia sebi PXP-89 in a hypersaline medium |
| P703 | Found in taxon | Xanthium sibiricum | Q8175097 |  |  |  |  | normal | Chemical constituents from the roots of Xanthium sibiricum |
| P703 | Found in taxon | Petrosiidae | Q3901103 |  |  |  |  | normal | New manzamine alkaloids with activity against infectious and tropical parasitic diseases from an Indonesian sponge. |
| P703 | Found in taxon | Penicillium commune | Q10622907 |  |  |  |  | normal | Chemical constituents of a marine-derived endophytic fungus Penicillium commune G2M. |
| P703 | Found in taxon | Nocardia alba | Q26268672 |  |  |  |  | normal | (1)H and (13)C NMR assignments of eight nitrogen containing compounds from Nocardia alba sp.nov (YIM 30243(T)). |
| P703 | Found in taxon | Caenorhabditis elegans | Q91703 |  |  |  |  | normal | Modeling Meets Metabolomics-The WormJam Consensus Model as Basis for Metabolic Studies in the Model Organism \| Cross-Platform Comparison of Caenorhabditis elegans Tissue Extraction Strategies for Comprehensive Metabolome Coverage |
| P703 | Found in taxon | Escherichia coli | Q25419 |  |  |  |  | normal | A comprehensive genome-scale reconstruction of Escherichia coli metabolism--2011. \| MECHANISM OF ACTION OF NALIDIXIC ACID ON ESCHERICHIA COLI.II. INHIBITION OF DEOXYRIBONUCLEIC ACID SYNTHESIS. |
| P703 | Found in taxon | Portulaca oleracea | Q158015 |  |  |  |  | normal | Homoisoflavonoids from the medicinal plant Portulaca oleracea |
| P703 | Found in taxon | Habenaria digitata | Q15479951 |  |  |  |  | normal | Phenolic phytochemistry, in vitro, in silico, in vivo, and mechanistic anti-inflammatory and antioxidant evaluations of Habenaria digitata |
| P2101 | Melting point | 317°C |  | 317 | °C |  |  | normal | Jean-Claude Bradley Open Melting Point Dataset |
| P361 | Part of | thymine binding | Q21173258 |  |  |  |  | normal | Gene Ontology release 2019-11-16 |
| P361 | Part of | thymine catabolic process | Q21118003 |  |  |  |  | normal | Gene Ontology release 2019-11-16 |
| P361 | Part of | thymine biosynthetic process | Q22275501 |  |  |  |  | normal | Gene Ontology release 2019-11-16 |
| P361 | Part of | thymine transport | Q22290421 |  |  |  |  | normal | Gene Ontology release 2019-11-16 |
| P361 | Part of | thymine metabolic process | Q21118776 |  |  |  |  | normal | Gene Ontology release 2020-05-02 |
| P361 | Part of | thymidine phosphorylase activity | Q21158662 |  |  |  |  | normal | Gene Ontology release 2020-05-02 |
| P361 | Part of | thymine dioxygenase activity | Q22316435 |  |  |  |  | normal | Gene Ontology release 2020-05-02 |
| P361 | Part of | thymine dehydrogenase activity | Q22317911 |  |  |  |  | normal | http://geneontology.org/external2go/rhea2go |
| P2868 | Subject has role | primary metabolite | Q3333419 |  |  |  |  | normal | https://reactome.org/PathwayBrowser/#/R-HSA-1430728&DTAB=MT |
| P2581 | BabelNet ID | 00075783n |  |  |  |  |  | normal | https://babelnet.org/synset?id=bn%00075783n&lang=EN |
| P8072 | CAB ID | 279917 |  |  |  |  |  | normal | https://www.cabi.org/cabithesaurus/mtwdk.exe?k=default&l=60&w=279917&s=5&t=2 |
| P231 | CAS Registry Number | 65-71-4 |  |  |  |  |  | normal | https://commonchemistry.cas.org/detail?cas_rn=65-71-4 |
| P683 | ChEBI ID | 17821 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:17821 |
| P592 | ChEMBL ID | CHEMBL993 |  |  |  |  |  | normal | https://www.ebi.ac.uk/chembl/compound_report_card/CHEMBL993/ |
| P661 | ChemSpider ID | 1103 |  |  |  |  |  | normal | https://www.chemspider.com/Chemical-Structure.1103.html |
| P3073 | CosIng number | 59742 |  |  |  |  |  | normal | https://ec.europa.eu/growth/tools-databases/cosing/details/59742 |
| P715 | DrugBank ID | DB03462 |  |  |  |  |  | normal | https://go.drugbank.com/drugs/DB03462 |
| P8494 | DSSTOX compound identifier | DTXCID4030914 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/DTXCID4030914 |
| P3117 | DSSTox substance ID | DTXSID4052342 |  |  |  |  |  | normal | https://comptox.epa.gov/dashboard/chemical/details/DTXSID4052342 |
| P232 | EC number | 200-616-1 |  |  |  |  |  | normal | https://www.echa.europa.eu/information-on-chemicals/ec-inventory/-/dislist/details/200-616-1 |
| P2566 | ECHA Substance Infocard ID | 100.000.560 |  |  |  |  |  | normal | https://www.echa.europa.eu/substance-information/-/substanceinfo/100.000.560 |
| P4746 | Elhuyar ZTH ID | 031179 |  |  |  |  |  | normal | https://zthiztegia.elhuyar.eus/kontzeptua/031179 |
| P1417 | Encyclopædia Britannica Online ID | science/thymine |  |  |  |  |  | normal | https://www.britannica.com/science/thymine |
| P646 | Freebase ID | /m/0f_ph |  |  |  |  |  | normal | https://www.google.com/search?kgmid=/m/0f_ph |
| P1578 | Gmelin number | 278790 |  |  |  |  |  | normal |  |
| P4342 | Great Norwegian Encyclopedia ID | tymin |  |  |  |  |  | normal | https://wikidata-externalid-url.toolforge.org/?p=4342&url_prefix=https://snl.no/&id=tymin |
| P2924 | Great Russian Encyclopedia Online ID (2017) | 4191948 |  |  |  |  |  | normal | https://web.archive.org/web/0/old.bigenc.ru/text/4191948 |
| P595 | Guide to Pharmacology Ligand ID | 4581 |  |  |  |  |  | normal | https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4581 |
| P2057 | Human Metabolome Database ID | HMDB0000262 |  |  |  |  |  | normal | https://www.hmdb.ca/metabolites/HMDB0000262 |
| P4168 | IEDB Epitope ID | 167476 |  |  |  |  |  | normal | http://www.iedb.org/epitope/167476 |
| P234 | InChI | InChI=1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |  |  |  |  |  | normal | https://chemapps.stolaf.edu/jmol/jmol.php?&model=InChI%3D1S/C5H6N2O2/c1-3-2-6-5(9)7-4(3)8/h2H%2C1H3%2C(H2%2C6%2C7%2C8%2C9) |
| P235 | InChIKey | RWQNBRDOKXIBIV-UHFFFAOYSA-N |  |  |  |  |  | normal | https://www.ncbi.nlm.nih.gov/sites/entrez?cmd=search&db=pccompound&term=%22RWQNBRDOKXIBIV-UHFFFAOYSA-N%22%5BInChIKey%5D |
| P8189 | J9U entity ID | 987007536578805171 |  |  |  |  |  | normal | https://www.nli.org.il/en/authorities/987007536578805171 |
| P3827 | JSTOR topic ID (archived) | thymine-nucleotides |  |  |  |  |  | normal | https://web.archive.org/web/*/https://www.jstor.org/topic/thymine-nucleotides |
| P665 | KEGG ID | C00178 |  |  |  |  |  | normal | https://www.kegg.jp/entry/C00178 |
| P2064 | KNApSAcK ID | C00001511 |  |  |  |  |  | normal | https://www.knapsackfamily.com/knapsack_core/information.php?sname=C_ID&word=C00001511 |
| P8313 | Lex ID | thymin |  |  |  |  |  | normal | https://wikidata-externalid-url.toolforge.org/?p=8313&url_prefix=https://lex.dk/&id=thymin |
| P244 | Library of Congress Authorities ID | sh85135141 |  |  |  |  |  | normal | https://id.loc.gov/authorities/sh85135141 |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP009500 |  |  |  |  |  | normal | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Fac_Eng_Univ_Tokyo-JP009500 |
| P486 | MeSH descriptor ID | D013941 |  |  |  |  |  | normal | https://meshb.nlm.nih.gov/record/ui?ui=D013941 |
| P672 | MeSH tree code | D03.383.742.698.875.899 |  |  |  |  |  | normal | https://id.nlm.nih.gov/mesh/D03.383.742.698.875.899 |
| P6366 | Microsoft Academic ID (discontinued) | 2776858809 |  |  |  |  |  | normal | https://web.archive.org/web/https://academic.microsoft.com/v2/detail/2776858809 |
| P3222 | NE.se ID | tymin |  |  |  |  |  | normal | https://www.ne.se/uppslagsverk/encyklopedi/lång/tymin |
| P9405 | NMRShiftDB structure ID | 10016337 |  |  |  |  |  | normal | https://nmrshiftdb.nmr.uni-koeln.de/molecule/10016337 |
| P2840 | NSC number | 14705 |  |  |  |  |  | normal | https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&chemnameboolean=and&outputformat=html&searchlist=14705&Submit=Submit |
| P1245 | OmegaWiki Defined Meaning | 799370 |  |  |  |  |  | normal | http://www.omegawiki.org/DefinedMeaning:(799370) |
| P10283 | OpenAlex ID | C2776858809 |  |  |  |  |  | normal | https://openalex.org/C2776858809 |
| P3636 | PDB ligand ID | TDR |  |  |  |  |  | normal | https://www.rcsb.org/ligand/TDR |
| P638 | PDB structure ID | 2HN9 |  |  |  |  |  | normal | https://www.rcsb.org/structure/2HN9 |
| P11199 | Probes And Drugs ID | PD007511 |  |  |  |  |  | normal | https://www.probes-drugs.org/compound/PD007511 |
| P1051 | PSH ID | 6252 |  |  |  |  |  | normal | https://psh.techlib.cz/skos/PSH6252 |
| P662 | PubChem CID | 1135 |  |  |  |  |  | normal | https://pubchem.ncbi.nlm.nih.gov/compound/1135 |
| P3417 | Quora topic ID | Thymine |  |  |  |  |  | normal | https://www.quora.com/topic/Thymine |
| P1579 | Reaxys registry number | 607626 |  |  |  |  |  | normal |  |
| P5076 | Römpp online ID | RD-20-01678 |  |  |  |  |  | normal | https://roempp.thieme.de/lexicon/RD-20-01678 |
| P3345 | RxNorm CUI | 1368871 |  |  |  |  |  | normal | https://mor.nlm.nih.gov/RxNav/search?searchBy=RXCUI&searchTerm=1368871 |
| P10376 | ScienceDirect topic ID | biochemistry-genetics-and-molecular-biology/thymine |  |  |  |  |  | normal | https://www.sciencedirect.com/topics/biochemistry-genetics-and-molecular-biology/thymine |
| P4964 | SPLASH | splash10-0bt9-0960000000-50722d1f64f22b69e207 |  |  |  |  |  | normal | https://mona.fiehnlab.ucdavis.edu/spectra/browse?query=exists(splash.splash:'splash10-0bt9-0960000000-50722d1f64f22b69e207') |
| P2877 | SureChEMBL ID | 2322416 |  |  |  |  |  | normal | https://www.surechembl.org/chemical/2322416 |
| P3365 | Treccani ID | timina |  |  |  |  |  | normal | https://www.treccani.it/enciclopedia/timina |
| P10017 | Treccani's Dizionario delle Scienze Fisiche ID | timina |  |  |  |  |  | normal | https://www.treccani.it/enciclopedia/timina_(Dizionario-delle-Scienze-Fisiche) |
| P10022 | Treccani's Dizionario di Medicina ID | timina |  |  |  |  |  | normal | https://www.treccani.it/enciclopedia/timina_(Dizionario-di-Medicina) |
| P2892 | UMLS CUI | C0040087 |  |  |  |  |  | normal | https://evsexplore.semantics.cancer.gov/evsexplore/concept/ncim/C0040087 |
| P11089 | UniChem compound ID | 11271 |  |  |  |  |  | normal | https://www.ebi.ac.uk/unichem/compoundsources?type=uci&compound=11271 |
| P652 | UNII | QR26YLT7LT |  |  |  |  |  | normal | https://gsrs.ncats.nih.gov/ginas/app/beta/substances/QR26YLT7LT |
| P3471 | WikiSkripta article ID | 52778 |  |  |  |  |  | normal | https://www.wikiskripta.eu/index.php?curid=52778 |
| P8814 | WordNet 3.1 Synset ID | 15097424-n |  |  |  |  |  | normal | https://en-word.net/view/synset/15097424-n |

Source: https://aidb.si/e/thymine-Q171973 — Wikidata (CC0) via AIDB